CAS 247569-90-0
:4-(Bromomethyl)-1-chloro-2-ethoxybenzene
Description:
4-(Bromomethyl)-1-chloro-2-ethoxybenzene, with the CAS number 247569-90-0, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromomethyl group, a chlorine atom, and an ethoxy group. The presence of these substituents influences its chemical reactivity and physical properties. Typically, compounds like this exhibit moderate polarity due to the electronegative halogen atoms, which can affect solubility in various solvents. The bromomethyl group can serve as a reactive site for further chemical transformations, making it useful in synthetic organic chemistry. Additionally, the ethoxy group can enhance the compound's solubility in organic solvents and may influence its biological activity. The compound's reactivity may also be affected by the electron-withdrawing nature of the chlorine atom, which can stabilize certain intermediates during chemical reactions. Overall, 4-(Bromomethyl)-1-chloro-2-ethoxybenzene is a versatile compound with potential applications in pharmaceuticals and materials science.
Formula:C9H10BrClO
InChI:InChI=1S/C9H10BrClO/c1-2-12-9-5-7(6-10)3-4-8(9)11/h3-5H,2,6H2,1H3
InChI key:InChIKey=YFVHKXBOEACTME-UHFFFAOYSA-N
SMILES:O(CC)C1=CC(CBr)=CC=C1Cl
Synonyms:- 4-(Bromomethyl)-1-chloro-2-ethoxybenzene
- Benzene, 4-(bromomethyl)-1-chloro-2-ethoxy-
- 4-Chloro-3-ethoxybenzyl bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
