CAS 24758-49-4
:4-Morpholinobenzophenone
Description:
4-Morpholinobenzophenone, with the CAS number 24758-49-4, is an organic compound that belongs to the class of benzophenones, which are known for their applications in photoinitiators and UV absorbers. This compound features a morpholine ring, which contributes to its unique chemical properties, including its solubility and reactivity. It typically appears as a solid or crystalline substance and is characterized by its ability to absorb ultraviolet light, making it useful in various formulations, such as coatings, adhesives, and plastics, to prevent degradation from UV exposure. The presence of the morpholine group enhances its compatibility with different solvents and polymers. Additionally, 4-Morpholinobenzophenone may exhibit biological activity, which necessitates careful handling and consideration of safety protocols during its use. As with many chemical substances, it is important to consult safety data sheets for information on toxicity, handling, and environmental impact. Overall, this compound plays a significant role in materials science and photochemistry due to its functional properties.
Formula:C17H17NO2
InChI:InChI=1S/C17H17NO2/c19-17(14-4-2-1-3-5-14)15-6-8-16(9-7-15)18-10-12-20-13-11-18/h1-9H,10-13H2
InChI key:InChIKey=CGCQHMFVCNWSOV-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(C=C1)N2CCOCC2)C3=CC=CC=C3
Synonyms:- (4-Morpholinophenyl)(phenyl)methanone
- Ama 57
- Benzophenone, 4-morpholino-
- Methanone, [4-(4-morpholinyl)phenyl]phenyl-
- N-(4-Benzoylphenyl)morpholine
- Nsc 111168
- [4-(4-Morpholinyl)phenyl]phenylmethanone
- [4-(Morpholin-4-Yl)Phenyl](Phenyl)Methanone
- 4-Morpholinobenzophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(4-Morpholinophenyl)(phenyl)methanone
CAS:Formula:C17H17NO2Color and Shape:SolidMolecular weight:267.3224

