
CAS 247592-74-1
:2-(4-Formyl-2-methoxyphenoxy)-N-(4-nitrophenyl)acetamide
Description:
2-(4-Formyl-2-methoxyphenoxy)-N-(4-nitrophenyl)acetamide is a chemical compound characterized by its complex structure, which includes a formyl group, a methoxy group, and a nitrophenyl moiety. This compound features an acetamide functional group, indicating it has both amide and aldehyde characteristics. The presence of the methoxy group suggests potential for increased lipophilicity, which may influence its solubility and reactivity. The nitrophenyl group can impart significant electronic effects, potentially enhancing the compound's reactivity in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit biological activity due to its structural components, making it of interest in medicinal chemistry. Its molecular interactions could be influenced by hydrogen bonding capabilities, given the presence of the amide and aldehyde functionalities. Overall, this compound's unique combination of functional groups positions it as a potentially valuable entity in various chemical and pharmaceutical applications.
Formula:C16H14N2O6
InChI:InChI=1S/C16H14N2O6/c1-23-15-8-11(9-19)2-7-14(15)24-10-16(20)17-12-3-5-13(6-4-12)18(21)22/h2-9H,10H2,1H3,(H,17,20)
InChI key:InChIKey=SELOVHZBRNGRRF-UHFFFAOYSA-N
SMILES:O(CC(NC1=CC=C(N(=O)=O)C=C1)=O)C2=C(OC)C=C(C=O)C=C2
Synonyms:- Acetamide, 2-(4-formyl-2-methoxyphenoxy)-N-(4-nitrophenyl)-
- 2-(4-Formyl-2-methoxyphenoxy)-N-(4-nitrophenyl)acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.