CAS 24769-56-0
:11α-Hydroxy-9,15-dioxo-2,3,4,5-tetranorprostane-1,20-dioic acid
Description:
11α-Hydroxy-9,15-dioxo-2,3,4,5-tetranorprostane-1,20-dioic acid, with CAS number 24769-56-0, is a synthetic compound that belongs to the class of prostaglandin analogs. This substance is characterized by its complex molecular structure, which includes multiple functional groups such as hydroxyl (-OH) and carboxylic acid (-COOH) groups, contributing to its biological activity. It is known for its role in modulating various physiological processes, particularly in the context of inflammation and vascular function. The presence of dioxo groups indicates potential reactivity and interactions with biological macromolecules. This compound is typically studied for its pharmacological properties and potential therapeutic applications, particularly in the fields of cardiology and immunology. Its stability, solubility, and reactivity can vary based on environmental conditions, making it important to consider these factors in experimental settings. Overall, 11α-Hydroxy-9,15-dioxo-2,3,4,5-tetranorprostane-1,20-dioic acid represents a significant interest in medicinal chemistry and pharmacology.
Formula:C16H24O7
InChI:InChI=1S/C16H24O7/c17-10(3-1-2-4-15(20)21)5-6-11-12(7-8-16(22)23)14(19)9-13(11)18/h11-13,18H,1-9H2,(H,20,21)(H,22,23)/t11-,12-,13-/m1/s1
InChI key:InChIKey=ZJAZCYLYLVCSNH-JHJVBQTASA-N
SMILES:C(CC(CCCCC(O)=O)=O)[C@@H]1[C@@H](CCC(O)=O)C(=O)C[C@H]1O
Synonyms:- Cyclopentaneoctanoic acid, 2-(2-carboxyethyl)-5-hydroxy-ε,3-dioxo-, stereoisomer
- (1R,2R,5R)-2-(2-Carboxyethyl)-5-hydroxy-ε,3-dioxocyclopentaneoctanoic acid
- 7-Hydroxy-5,11-diketotetranorprosta-1,16-dioic acid
- Cyclopentaneoctanoic acid, 2-(2-carboxyethyl)-5-hydroxy-ε,3-dioxo-, [1R-(1α,2β,5β)]-
- Cyclopentaneoctanoic acid, 2-(2-carboxyethyl)-5-hydroxy-ε,3-dioxo-, (1R,2R,5R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
tetranor-PGEM
CAS:Tetranor-PGEM, the primary urinary byproduct of PGE1 and PGE2, marks PGE2 production; humans excrete 7-40 μg daily.Formula:C16H24O7Color and Shape:SolidMolecular weight:328.361Ref: 4Z-P-144051
Discontinued product

