CAS 2477-61-4
:17-Hydroxypregna-1,4-diene-3,20-dione
Description:
17-Hydroxypregna-1,4-diene-3,20-dione, commonly known as 17-hydroxyprogesterone, is a steroid hormone that plays a crucial role in the regulation of various physiological processes, particularly in the reproductive system. It is a derivative of progesterone and is involved in the synthesis of other steroid hormones. This compound is characterized by its hydroxyl group at the 17th carbon position and a double bond between the first and fourth carbon atoms in its steroid structure. It is typically found in the adrenal glands and gonads and is essential for maintaining pregnancy and regulating the menstrual cycle. In clinical settings, 17-hydroxyprogesterone is often measured to assess adrenal function and diagnose conditions such as congenital adrenal hyperplasia. The substance is also used therapeutically in certain hormone replacement therapies. Its CAS number, 2477-61-4, is a unique identifier that facilitates its identification in chemical databases and regulatory documents.
Formula:C21H28O3
InChI:InChI=1S/C21H28O3/c1-13(22)21(24)11-8-18-16-5-4-14-12-15(23)6-9-19(14,2)17(16)7-10-20(18,21)3/h6,9,12,16-18,24H,4-5,7-8,10-11H2,1-3H3/t16-,17+,18+,19+,20+,21+/m1/s1
InChI key:InChIKey=JQVUIHNKYYECGH-CEGNMAFCSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)C(CC3)=CC(=O)C=C4)(CC1)[H])[H])(CC[C@@]2(C(C)=O)O)[H]
Synonyms:- Pregna-1,4-diene-3,20-dione, 17-hydroxy-
- 17-Hydroxypregna-1,4-diene-3,20-dione
- 17α-Hydroxypregna-1,4-diene-3,20-dione
- NSC 9786
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
