CAS 24771-25-3
:Carbonimidic acid, N-cyano-, dimethyl ester
Description:
Carbonimidic acid, N-cyano-, dimethyl ester, also known by its CAS number 24771-25-3, is an organic compound characterized by its functional groups, which include a cyano group and an ester. This compound typically appears as a colorless to pale yellow liquid and is known for its relatively low volatility. It is soluble in organic solvents, making it useful in various chemical reactions and applications. The presence of the cyano group imparts unique reactivity, allowing it to participate in nucleophilic addition reactions. Additionally, the dimethyl ester moiety contributes to its stability and solubility properties. Carbonimidic acid derivatives are often explored in synthetic organic chemistry for their potential applications in pharmaceuticals and agrochemicals. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested. Overall, this compound exemplifies the diverse chemistry associated with carbon-based compounds, particularly those featuring cyano and ester functionalities.
Formula:C4H6N2O2
InChI:InChI=1S/C4H6N2O2/c1-7-4(8-2)6-3-5/h1-2H3
InChI key:InChIKey=ZOKYZTUQSVAKHS-UHFFFAOYSA-N
SMILES:C(=NC#N)(OC)OC
Synonyms:- Brn 1852979
- Carbonimidic acid, N-cyano-, dimethyl ester
- Carbonimidic acid, cyano-, dimethyl ester
- Dimethyl (N-cyanoimido)carbonate
- Dimethyl cyanocarbonimidate
- Dimidocarbonic acid, cyano-, dimethyl ester
- Imidocarbonic acid, cyano-, dimethyl ester
- Imidocarbonic acid, cyano-, dimethyl ester (8CI)
- Sk&F 107533
- Dimethyl cyanoimidocarbonate
- Dimethyl-N-cyanoiminocarbonate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
methyl N-cyanomethoxycarboximidate
CAS:Formula:C4H6N2O2Color and Shape:SolidMolecular weight:114.1026

