CAS 24779-68-8
:1-Adamantylmalonic acid
Description:
1-Adamantylmalonic acid is an organic compound characterized by its unique structure, which includes an adamantyl group attached to a malonic acid moiety. This compound features a rigid, cage-like adamantane structure, contributing to its distinctive physical and chemical properties. Typically, 1-adamantylmalonic acid is a white crystalline solid that is soluble in polar solvents, such as water and alcohols, due to the presence of carboxylic acid functional groups. The compound exhibits acidic behavior, as it can donate protons from its carboxylic groups. Its molecular structure allows for potential applications in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. Additionally, the presence of the adamantyl group may enhance the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry. Overall, 1-adamantylmalonic acid serves as a versatile building block in various chemical reactions and applications, owing to its unique structural features and functional properties.
Formula:C13H18O4
InChI:InChI=1/C13H18O4/c14-11(15)10(12(16)17)13-4-7-1-8(5-13)3-9(2-7)6-13/h7-10H,1-6H2,(H,14,15)(H,16,17)
SMILES:C1C2CC3CC1CC(C2)(C3)C(C(=O)O)C(=O)O
Synonyms:- Adamantan-1-ylmalonic acid
- Propanedioic Acid, 2-Tricyclo[3.3.1.1~3,7~]Dec-1-Yl-
- Tricyclo[3.3.1.1~3,7~]Dec-1-Ylpropanedioic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1-Adamantylmalonic acid
CAS:1-Adamantylmalonic acid is a hydrolytic impurity of the drug adamantine, which belongs to the class of anti-inflammatory drugs. It has been shown that 1-Adamantylmalonic acid can be produced by hydrolysis when piperidine is added to a reaction solution containing malonic acid and an alicyclic compound with a constant structure. The responsiveness of 1-Adamantylmalonic acid to light has been determined in several experiments. It has been shown that this impurity is stable, but it is more sensitive to light than adamantine. Optical properties have also been studied and it was found that 1-Adamantylmalonic acid absorbs in the ultraviolet region and fluoresces at wavelengths between 300 and 320 nm.Formula:C13H18O4Purity:Min. 95%Color and Shape:PowderMolecular weight:238.28 g/mol

