CAS 24786-48-9

2H-Benzimidazol-2-one, 5-amino-1,3-diethyl-1,3-dihydro-, hydrochloride (1:1)

Description:

2H-Benzimidazol-2-one, 5-amino-1,3-diethyl-1,3-dihydro-, hydrochloride (1:1), with CAS number 24786-48-9, is a chemical compound characterized by its benzimidazole core structure, which is a bicyclic compound featuring a fused benzene and imidazole ring. This substance typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility and stability. The compound contains amino and diethyl substituents that contribute to its biological activity and potential pharmacological properties. It may exhibit various biological activities, including antimicrobial or antifungal effects, making it of interest in medicinal chemistry. The hydrochloride form indicates that it is a salt, which can influence its pharmacokinetics and bioavailability. As with many organic compounds, proper handling and safety precautions are essential, as it may pose health risks if ingested or improperly managed.

Formula: C₁₁H₁₅N₃O·ClH

InChI: InChI=1S/C11H15N3O.ClH/c1-3-13-9-6-5-8(12)7-10(9)14(4-2)11(13)15;/h5-7H,3-4,12H2,1-2H3;1H

InChI key: InChIKey=YLXUIVOFLBGAEX-UHFFFAOYSA-N

SMILES: C(C)N1C=2C(N(CC)C1=O)=CC=C(N)C2.Cl

Synonyms:

• 2-Benzimidazolinone, 5-amino-1,3-diethyl-, monohydrochloride
• 2H-Benzimidazol-2-one, 5-amino-1,3-diethyl-1,3-dihydro-, hydrochloride (1:1)