CymitQuimica logo

CAS 247907-28-4

:

N-(2-fluorobenzyl)-2-methoxyethanamine

Description:
N-(2-fluorobenzyl)-2-methoxyethanamine is a chemical compound characterized by its unique structure, which includes a fluorobenzyl group and a methoxyethanamine moiety. This compound features a fluorine atom attached to a benzene ring, which can influence its reactivity and biological activity due to the electronegative nature of fluorine. The methoxyethanamine part of the molecule contributes to its potential as a ligand in various chemical reactions and biological interactions. Typically, compounds like this may exhibit properties such as moderate solubility in organic solvents and potential activity in pharmacological applications, particularly in the realm of medicinal chemistry. The presence of both the fluorobenzyl and methoxy groups suggests that it may interact with biological targets, making it of interest in drug development. Additionally, the compound's molecular weight, boiling point, and melting point would be relevant for practical applications, although specific values would need to be referenced from chemical databases or literature for precise information.
Formula:C10H14FNO
InChI:InChI=1/C10H14FNO/c1-13-7-6-12-8-9-4-2-3-5-10(9)11/h2-5,12H,6-8H2,1H3
SMILES:COCCNCc1ccccc1F
Synonyms:
  • benzenemethanamine, 2-fluoro-N-(2-methoxyethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.