CymitQuimica logo

CAS 247939-84-0

:

(3R)-3-(methylamino)-2,3,4,9-tetrahydro-1H-carbazole-6-carbonitrile

Description:
(3R)-3-(methylamino)-2,3,4,9-tetrahydro-1H-carbazole-6-carbonitrile is a chemical compound characterized by its complex bicyclic structure, which includes a carbazole moiety. This compound features a methylamino group at the 3-position and a carbonitrile functional group at the 6-position, contributing to its potential biological activity. The tetrahydro configuration indicates that it contains a saturated ring system, which can influence its reactivity and interactions with biological targets. The presence of the carbonitrile group suggests potential for hydrogen bonding and dipole interactions, which may enhance its solubility and reactivity in various chemical environments. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry and drug development. Its stereochemistry, denoted by the (3R) designation, indicates a specific three-dimensional arrangement that can significantly affect its biological activity and interactions with receptors or enzymes. Overall, this compound represents a unique structure with potential applications in pharmaceuticals and research.
Formula:C14H15N3
InChI:InChI=1/C14H15N3/c1-16-10-3-5-14-12(7-10)11-6-9(8-15)2-4-13(11)17-14/h2,4,6,10,16-17H,3,5,7H2,1H3/t10-/m1/s1
SMILES:CN[C@@H]1CCc2c(C1)c1cc(ccc1[nH]2)C#N
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.