CAS 24803-99-4: 2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine ni
Description:2,3,7,8,12,13,17,18-octaethyl-21H,23H-porphine nickel (NiOEP) is a synthetic porphyrin compound characterized by its complex macrocyclic structure, which includes a central nickel ion coordinated to a porphyrin ring with eight ethyl substituents. This compound exhibits notable solubility in organic solvents due to the presence of the ethyl groups, which enhance its hydrophobic properties. NiOEP is recognized for its strong light-absorbing capabilities, particularly in the visible region, making it useful in various applications such as photodynamic therapy, solar energy conversion, and as a catalyst in organic reactions. The nickel ion in the center of the porphyrin plays a crucial role in its electronic properties, allowing for unique redox behavior. Additionally, NiOEP can participate in coordination chemistry, forming complexes with other ligands. Its stability and reactivity are influenced by the steric and electronic effects of the ethyl groups, making it a subject of interest in both theoretical and applied chemistry research.
Formula:C36H44N4Ni
InChI:InChI=1/C36H44N4.Ni/c1-9-21-22(10-2)30-18-32-25(13-5)26(14-6)34(39-32)20-36-28(16-8)27(15-7)35(40-36)19-33-24(12-4)23(11-3)31(38-33)17-29(21)37-30;/h17-20H,9-16H2,1-8H3;/q-2;+2/b29-17-,30-18u,31-17u,32-18-,33-19u,34-20u,35-19u,36-20u;
- Synonyms:
- 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE NICKEL(II) REF: IN-DA00C1A0CAS: 24803-99-4 | 97% | 189.00 €~457.00 € | Mon 07 Apr 25 |
![]() | Ni(II) Octaethylporphine REF: FT-NiO534CAS: 24803-99-4 | >95% | To inquire | Tue 08 Apr 25 |
![]() | 2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II) REF: 3D-FO165676CAS: 24803-99-4 | Min. 95% | - - - | Discontinued product |

2,3,7,8,12,13,17,18-OCTAETHYL-21H,23H-PORPHINE NICKEL(II)
Ref: IN-DA00C1A0
25mg | 189.00 € | ||
100mg | 457.00 € |

Ref: FT-NiO534
1g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

2,3,7,8,12,13,17,18-Octaethyl-21H,23H-porphine nickel(II)
Ref: 3D-FO165676
Undefined size | Discontinued | Request information |