
CAS 24808-87-5
:21-(3-Carboxy-1-oxopropoxy)-17-hydroxypregna-1,4-diene-3,11,20-trione
Description:
The chemical substance known as 21-(3-Carboxy-1-oxopropoxy)-17-hydroxypregna-1,4-diene-3,11,20-trione, with the CAS number 24808-87-5, is a synthetic steroid derivative. It is characterized by a complex molecular structure that includes multiple functional groups, such as carboxylic acid and ketone moieties, which contribute to its reactivity and biological activity. This compound is part of the broader class of corticosteroids, which are known for their anti-inflammatory and immunosuppressive properties. The presence of hydroxyl groups enhances its solubility and interaction with biological systems. Its specific configuration and stereochemistry are crucial for its pharmacological effects, influencing how it binds to steroid receptors. This compound may be studied for its potential therapeutic applications, particularly in the fields of endocrinology and pharmacology. However, detailed studies on its efficacy, safety, and mechanism of action would be necessary to fully understand its role in medicinal chemistry.
Formula:C25H30O8
InChI:InChI=1S/C25H30O8/c1-23-9-7-15(26)11-14(23)3-4-16-17-8-10-25(32,24(17,2)12-18(27)22(16)23)19(28)13-33-21(31)6-5-20(29)30/h7,9,11,16-17,22,32H,3-6,8,10,12-13H2,1-2H3,(H,29,30)/t16-,17-,22+,23-,24-,25-/m0/s1
InChI key:InChIKey=IMWBZDUOZWSUQI-WFLBVZAHSA-N
SMILES:C[C@@]12[C@]([C@]3([C@](C(=O)C1)([C@]4(C)C(CC3)=CC(=O)C=C4)[H])[H])(CC[C@@]2(C(COC(CCC(O)=O)=O)=O)O)[H]
Synonyms:- Succinic acid, 21-monoester with 17,21-dihydroxypregna-1,4-diene-3,11,20-trione
- Pregna-1,4-diene-3,11,20-trione, 17,21-dihydroxy-, 21-succinate
- 21-(3-Carboxy-1-oxopropoxy)-17-hydroxypregna-1,4-diene-3,11,20-trione
- Pregna-1,4-diene-3,11,20-trione, 21-(3-carboxy-1-oxopropoxy)-17-hydroxy-
- Pregna-1,4-diene-3,11,20-trione, 17,21-dihydroxy-, 21-(hydrogen succinate)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
