CAS 2482-00-0: (4-aminobutyl)guanidinium sulphate
Description:(4-Aminobutyl)guanidinium sulfate is an organic compound characterized by its guanidinium functional group and an amino group attached to a butyl chain. It typically appears as a white crystalline solid and is soluble in water due to the presence of ionic and polar functional groups. This compound is often used in biochemical and pharmaceutical applications, particularly as a buffering agent or in the synthesis of other chemical entities. Its structure allows for hydrogen bonding, which can influence its solubility and reactivity. The presence of both amino and guanidinium groups contributes to its basicity, making it a potential candidate for various catalytic and biological processes. Additionally, (4-aminobutyl)guanidinium sulfate may exhibit specific biological activities, which can be of interest in medicinal chemistry and drug development. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C5H16N4O4S
InChI:InChI=1S/C5H14N4.H2O4S/c6-3-1-2-4-9-5(7)8;1-5(2,3)4/h1-4,6H2,(H4,7,8,9);(H2,1,2,3,4)
InChI key:InChIKey=PTAYFGHRDOMJGC-UHFFFAOYSA-N
SMILES:O=S(=O)(O)O.N=C(N)NCCCCN
- Synonyms:
- (4-Aminobutyl)guanidine sulphate
- (4-Aminobutyl)guanidinium sulfate
- 1-(4-Aminobutyl)guanidine sulfate
- 2-(4-Aminobutyl)Guanidine
- 2-(4-Aminobutyl)Guanidine Sulfate
- Agmatine Sulphate
- Agmatine sulfate
- Guanidine, (4-aminobutyl)-, sulfate (1:1)
- Guanidine, N-(4-aminobutyl)-, sulfate (1:1)
- Nih 11035
- See more synonyms
