CAS 24821-22-5
:2,6-Bis(trifluoromethyl)benzoic acid
Description:
2,6-Bis(trifluoromethyl)benzoic acid is an aromatic carboxylic acid characterized by the presence of two trifluoromethyl groups attached to the benzene ring at the 2 and 6 positions. This compound features a benzoic acid functional group, which contributes to its acidic properties. The trifluoromethyl groups significantly enhance the lipophilicity and electron-withdrawing characteristics of the molecule, influencing its reactivity and solubility in various solvents. Typically, it appears as a white crystalline solid and is known for its stability under standard conditions. The presence of the trifluoromethyl groups can also impart unique properties, such as increased thermal stability and altered biological activity. This compound is often utilized in organic synthesis and materials science, particularly in the development of fluorinated compounds and pharmaceuticals. Its CAS number, 24821-22-5, is a unique identifier that facilitates its recognition in chemical databases and regulatory frameworks. Overall, 2,6-Bis(trifluoromethyl)benzoic acid is a valuable compound in both research and industrial applications due to its distinctive chemical properties.
Formula:C9H4F6O2
InChI:InChI=1S/C9H4F6O2/c10-8(11,12)4-2-1-3-5(9(13,14)15)6(4)7(16)17/h1-3H,(H,16,17)
InChI key:InChIKey=XZNLSDPNMNWCRE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(C(F)(F)F)C=CC=C1C(F)(F)F
Synonyms:- 2,6-Bis(Trifluoromethyl)Benzoate
- 2,6-Di(trifluoromethyl)benzoic acid
- Benzoic acid, 2,6-bis(trifluoromethyl)-
- 2,6-Bis(trifluoromethyl)benzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2,6-Bis(trifluoromethyl)benzoic acid, 98%
CAS:2,6-Bis(trifluoromethyl)benzoic acid is used as an organic intermediate in synthesis. It is also used as a pharmaceutical intermediate and organic intermediate in chemical synthesis. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentFormula:C9H4F6O2Purity:98%Color and Shape:White to pale cream to pale yellow, Crystals or powder or crystalline powderMolecular weight:258.12Benzoic acid, 2,6-bis(trifluoromethyl)-
CAS:Formula:C9H4F6O2Purity:98%Color and Shape:SolidMolecular weight:258.11732,6-Bis(trifluoromethyl)benzoic acid
CAS:2,6-Bis(trifluoromethyl)benzoic acidFormula:C9H4F6O2Purity:98%Color and Shape: white crystalline powderMolecular weight:258.12g/mol2,6-Bis(trifluoromethyl)benzoic acid
CAS:Formula:C9H4F6O2Purity:98%Color and Shape:SolidMolecular weight:258.1192,6-Bistrifluoromethyl benzoic acid
CAS:2,6-Bistrifluoromethyl benzoic acid is a chiral compound that can be detected in urine samples at high concentrations. The compound can be detected by high-performance liquid chromatography (HPLC) after being derivatized with methyl ester. It has been shown to have a dihedral angle of about 180° and an enantiomeric purity of 99%. The efficient method for the synthesis of 2,6-Bistrifluoromethyl benzoic acid is also described. This method involves the use of a template molecule, which is prepared from 1-phenylethyl alcohol and 4-bromobutyraldehyde. The reaction proceeds smoothly using a solvent such as benzene or toluene in the presence of sodium borohydride. After purification, 2,6-Bistrifluoromethyl benzoic acid is obtained in excellent yield and enantiomerically pureFormula:C9H4F6O2Purity:Min. 95%Color and Shape:White To Light (Or Pale) Yellow SolidMolecular weight:258.12 g/mol





