CAS 248249-53-8

ethyl 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylate

Description:

Ethyl 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylate is a chemical compound characterized by its unique structural features, which include a thiazole ring and a benzodioxole moiety. This compound typically exhibits properties associated with both the thiazole and ester functional groups, such as moderate solubility in organic solvents and potential reactivity due to the presence of the carboxylate group. The thiazole ring contributes to its biological activity, often making it a subject of interest in medicinal chemistry for its potential pharmacological properties. The benzodioxole fragment may enhance its lipophilicity and influence its interaction with biological targets. Additionally, the compound may display fluorescence properties, making it useful in various applications, including as a probe in biochemical assays. Its CAS number, 248249-53-8, allows for easy identification in chemical databases, facilitating research and development in fields such as drug discovery and organic synthesis. Overall, this compound represents a blend of structural complexity and potential utility in various scientific domains.

Formula: C₁₃H₁₁NO₄S

InChI: InChI=1/C13H11NO4S/c1-2-16-13(15)9-6-19-12(14-9)8-3-4-10-11(5-8)18-7-17-10/h3-6H,2,7H2,1H3

SMILES: CCOC(=O)c1csc(c2ccc3c(c2)OCO3)n1

Synonyms:

• Ethyl 2-(1,3-benzodioxol-5-yl)-1,3-thiazole-4-carboxylate

2-Benzo[1,3]dioxol-5-yl-thiazole-4-carboxylic acid ethyl ester

CAS: 248249-53-8

Formula: C₁₃H₁₁NO₄S

Purity: %

Color and Shape: Solid

Molecular weight: 277.2957

Ref: IN-DA002PJY

Ethyl 2-(benzo[d][1,3]dioxol-5-yl)thiazole-4-carboxylate

CAS: 248249-53-8

Ethyl 2-(benzo[d][1,3]dioxol-5-yl)thiazole-4-carboxylate

Purity: 95%

Molecular weight: 277.3g/mol

Ref: 54-OR1004766

Ethyl 2-(benzo[d][1,3]dioxol-5-yl)thiazole-4-carboxylate

CAS: 248249-53-8

Purity: 95.0%

Molecular weight: 277.2900085449219

Ref: 10-F456738