CAS 248270-25-9
:3-Fluoro-4-formylbenzeneboronic acid
Description:
3-Fluoro-4-formylbenzeneboronic acid is an organic compound characterized by the presence of a boronic acid functional group, a formyl group, and a fluorine atom attached to a benzene ring. The molecular structure features a boron atom bonded to a hydroxyl group and an aryl group, which enhances its reactivity in various chemical reactions, particularly in Suzuki coupling reactions. The formyl group (-CHO) introduces an aldehyde functionality, making the compound useful in organic synthesis and as an intermediate in the preparation of more complex molecules. The fluorine atom contributes to the compound's electronic properties, potentially influencing its reactivity and solubility. This compound is typically used in medicinal chemistry and materials science due to its ability to form stable complexes with various substrates. Additionally, its boronic acid moiety allows for participation in cross-coupling reactions, making it valuable in the synthesis of pharmaceuticals and agrochemicals. As with many boronic acids, it is important to handle this compound with care, considering its potential reactivity and the need for appropriate storage conditions.
Formula:C7H6BFO3
InChI:InChI=1/C7H6BFO3/c9-7-3-6(8(11)12)2-1-5(7)4-10/h1-4,11-12H
SMILES:c1cc(cc(c1C=O)F)B(O)O
Synonyms:- 4-Borono-3-fluorobenzaldehyde
- 3-Fluoro-4-formylphenylboronic acid
- (3-Fluoro-4-Formylphenyl)Boronic Acid
- 3-Fluoro-4-formylphenylboronicacid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Fluoro-4-formylphenylboronic Acid (contains varying amounts of Anhydride)
CAS:Formula:C7H6BFO3Purity:97.0 to 113.0 %Color and Shape:White to Light yellow powder to crystalMolecular weight:167.933-Fluoro-4-formylbenzeneboronic acid, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H6BFO3Purity:98%Color and Shape:Pale cream to cream, PowderMolecular weight:167.93Boronic acid, B-(3-fluoro-4-formylphenyl)-
CAS:Formula:C7H6BFO3Purity:98%Color and Shape:SolidMolecular weight:167.93013-Fluoro-4-formylbenzeneboronic acid
CAS:3-Fluoro-4-formylbenzeneboronic acidFormula:C7H6BFO3Purity:98%Color and Shape: faint orange to orange crystalline solidMolecular weight:167.93g/mol3-Fluoro-4-formylphenboronic acid
CAS:Formula:C7H6BFO3Purity:97%Color and Shape:SolidMolecular weight:167.93




