CAS 2483-51-4
:N-[(Phenylmethoxy)carbonyl]-L-alanyl-L-alanine methyl ester
Description:
N-[(Phenylmethoxy)carbonyl]-L-alanyl-L-alanine methyl ester, with the CAS number 2483-51-4, is a synthetic compound that belongs to the class of amino acid derivatives. This substance features a phenylmethoxycarbonyl group, which enhances its stability and solubility, making it useful in various biochemical applications. The presence of two L-alanine residues contributes to its potential as a peptide mimic, which can be valuable in drug design and development. The methyl ester functionality indicates that it can undergo hydrolysis to release the corresponding amino acids, which may be relevant in biological systems. This compound is typically characterized by its molecular structure, which includes both hydrophobic and hydrophilic regions, allowing for interactions with biological membranes and proteins. Its applications may extend to research in peptide synthesis, enzyme inhibition studies, and as a building block in the development of more complex molecules. Overall, its unique structural features make it a compound of interest in the fields of medicinal chemistry and biochemistry.
Formula:C15H20N2O5
InChI:InChI=1S/C15H20N2O5/c1-10(13(18)16-11(2)14(19)21-3)17-15(20)22-9-12-7-5-4-6-8-12/h4-8,10-11H,9H2,1-3H3,(H,16,18)(H,17,20)/t10-,11-/m0/s1
InChI key:InChIKey=CUCAZZQPISJXOS-QWRGUYRKSA-N
SMILES:C(OC(N[C@H](C(N[C@H](C(OC)=O)C)=O)C)=O)C1=CC=CC=C1
Synonyms:- Alanine, N-(N-carboxy-L-alanyl)-, N-benzyl methyl ester, L-
- Alanine, N-(N-carboxy-L-alanyl)-, N-benzyl methyl ester
- N-[(Phenylmethoxy)carbonyl]-L-alanyl-L-alanine methyl ester
- L-Alanine, N-[N-[(phenylmethoxy)carbonyl]-L-alanyl]-, methyl ester
- L-Alanine, N-[(phenylmethoxy)carbonyl]-L-alanyl-, methyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-(Benzyloxycarbonyl)-L-alanyl-L-alanine methyl ester
CAS:Formula:C15H20N2O5Purity:97%Color and Shape:SolidMolecular weight:308.3297Z-Ala-Ala-OMe
CAS:Z-Ala-Ala-OMe is a serine protease inhibitor that binds to serine proteases, including chymotrypsin, trypsin, and elastase. The inhibition of these enzymes prevents the hydrolysis of proteins by these enzymes, which can lead to cell death. Z-Ala-Ala-OMe has been shown to inhibit the growth of bacteria in vitro and in animal models. This compound also showed an ability to inhibit the production of phosphite by immobilized subtilisin from Bacillus licheniformis (Bacillus subtilis) with a Km value of 0.5 mMFormula:C15H20N2O5Purity:Min. 95%Molecular weight:308.33 g/mol



