CAS 24845-40-7
:2-(4-methoxyphenyl)-1-phenylethanone
Description:
2-(4-Methoxyphenyl)-1-phenylethanone, also known as benzyl 4-methoxyphenyl ketone, is an organic compound characterized by its ketone functional group and aromatic structure. It features a phenyl group attached to a carbonyl (C=O) and a methoxy-substituted phenyl group, which contributes to its chemical properties. This compound is typically a solid at room temperature and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. It may exhibit photochemical properties, making it of interest in various applications, including organic synthesis and as a potential intermediate in the production of pharmaceuticals or agrochemicals. The presence of the methoxy group can influence its reactivity and stability, often enhancing its electron-donating characteristics. As with many organic compounds, safety precautions should be observed when handling it, as it may pose health risks if ingested or inhaled. Overall, 2-(4-methoxyphenyl)-1-phenylethanone is a versatile compound with potential applications in various fields of chemistry.
Formula:C15H14O2
InChI:InChI=1/C15H14O2/c1-17-14-9-7-12(8-10-14)11-15(16)13-5-3-2-4-6-13/h2-10H,11H2,1H3
SMILES:COc1ccc(cc1)CC(=O)c1ccccc1
Synonyms:- 2-(p-Methoxyphenyl)acetophenone
- Ethanone, 2-(4-methoxyphenyl)-1-phenyl-
- p-Methoxybenzyl phenyl ketone
- 2-(4-Methoxyphenyl)-1-phenylethanone
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Ethanone, 2-(4-methoxyphenyl)-1-phenyl-
CAS:Formula:C15H14O2Purity:97%Color and Shape:SolidMolecular weight:226.27052-(4-Methoxyphenyl)acetophenone
CAS:2-(4-Methoxyphenyl)acetophenonePurity:95%Molecular weight:226.27g/mol2-(4-Methoxyphenyl)acetophenone
CAS:Controlled Product<p>Applications An intermediate for the synthesis of many biologically active molecules including receptor ligands and enzyme inhibitors<br>References Miyashita, A., et al.: Chem. Pharm. Bull., 45, 1235 (1997), Collins, I., et al.: J. Med. Chem., 45, 1887 (2002), Miller, W.H., et al.: Bioorg. Med. Chem. Lett., 13, 1483 (2003),<br></p>Formula:C15H14O2Color and Shape:NeatMolecular weight:226.272-(4-Methoxyphenyl)-1-phenylethan-1-one
CAS:2-(4-Methoxyphenyl)-1-phenylethan-1-one is a versatile compound with various characteristics and applications. It is commonly used in research as a glyoxal derivative and dialkylamino compound. Additionally, it can be categorized as a research chemical due to its wide range of applications.Formula:C15H14O2Purity:Min. 95%Molecular weight:226.27 g/mol




