CAS 2485-71-4
:13-Methyltetradecanoic acid
Description:
13-Methyltetradecanoic acid, also known as 13-methyl-myristic acid, is a branched-chain fatty acid characterized by a long hydrocarbon chain with a methyl group located at the 13th carbon position. Its molecular formula is C15H30O2, indicating it contains 15 carbon atoms, 30 hydrogen atoms, and 2 oxygen atoms. This fatty acid is typically found in certain natural fats and oils, contributing to their unique properties. It is a solid at room temperature and exhibits typical fatty acid characteristics, such as being hydrophobic and insoluble in water, while being soluble in organic solvents. The presence of the methyl branch influences its melting point and physical properties compared to straight-chain fatty acids. 13-Methyltetradecanoic acid may also have applications in various fields, including biochemistry and materials science, due to its unique structural features. Its CAS number, 2485-71-4, is used for identification in chemical databases and regulatory contexts.
Formula:C15H30O2
InChI:InChI=1S/C15H30O2/c1-14(2)12-10-8-6-4-3-5-7-9-11-13-15(16)17/h14H,3-13H2,1-2H3,(H,16,17)
InChI key:InChIKey=ZOCYQVNGROEVLU-UHFFFAOYSA-N
SMILES:C(CC(C)C)CCCCCCCCCC(O)=O
Synonyms:- 13-Methylmyristate
- 13-Methyltetradecanoic acid
- 13-Mtd
- Isopentadecanoic acid
- Subtilopentadecanoic acid
- Tetradecanoic acid, 13-methyl-
- 13-Methylmyristic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
13-Methyltetradecanoic acid
CAS:Formula:C15H30O2Purity:>98%Color and Shape:SolidMolecular weight:242.413-Methyltetradecanoic acid
CAS:LeDSF3 controls HSAF production in Lysobacter, has antifungal properties, and acts as an anti-tumor by inhibiting p-AKT and activating caspase-3.Formula:C15H30O2Color and Shape:SolidMolecular weight:242.4Isopentadecanoic Acid
CAS:Controlled ProductFormula:C15H30O2Color and Shape:NeatMolecular weight:242.398Isopentadecanoic acid
CAS:Isopentadecanoic acid is a fatty acid that is found in adipose tissue. It is a major component of the oil solution obtained from hydrogenated vegetable oil. Isopentadecanoic acid has been shown to have therapeutic potential for autoimmune diseases, such as rheumatoid arthritis and multiple sclerosis. Isopentadecanoic acid inhibits the production of cytokines, which are proteins that regulate immune responses. It also inhibits the growth of bacteria by preventing protein synthesis, leading to cell death. The anti-inflammatory effects may be due to its ability to inhibit prostaglandin synthesis or block lipoxygenase activity.Formula:C15H30O2Purity:Min. 95%Molecular weight:242.4 g/mol





