CAS 24855-58-1
:4-Hydroxy-3-nitrobenzenesulfonamide
Description:
4-Hydroxy-3-nitrobenzenesulfonamide, with the CAS number 24855-58-1, is an organic compound that features a sulfonamide functional group, a nitro group, and a hydroxyl group attached to a benzene ring. This compound is characterized by its aromatic structure, which contributes to its stability and reactivity. The presence of the sulfonamide group imparts solubility in water and potential biological activity, making it of interest in pharmaceutical applications. The nitro group is known for its electron-withdrawing properties, which can influence the compound's reactivity and interaction with biological targets. Additionally, the hydroxyl group can participate in hydrogen bonding, enhancing its solubility and reactivity. Overall, 4-Hydroxy-3-nitrobenzenesulfonamide is notable for its potential use in medicinal chemistry, particularly in the development of antimicrobial agents or other therapeutic compounds. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require further investigation through experimental data.
Formula:C6H6N2O5S
InChI:InChI=1S/C6H6N2O5S/c7-14(12,13)4-1-2-6(9)5(3-4)8(10)11/h1-3,9H,(H2,7,12,13)
InChI key:InChIKey=SXSOYEBKXCZKDH-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=CC(S(N)(=O)=O)=CC=C1O
Synonyms:- 1-Phenol-4-sulfonamide, 2-nitro-
- 2-Nitro-4-sulfamide phenol
- 4-Hydroxy-3-nitrobenzenesulfonamide
- Benzenesulfonamide, 4-hydroxy-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
