CAS 248588-33-2

1-(3-fluorophenyl)cyclopropanecarboxylic acid

Description:

1-(3-Fluorophenyl)cyclopropanecarboxylic acid is an organic compound characterized by its cyclopropane structure, which is a three-membered carbon ring, and a carboxylic acid functional group. The presence of a fluorine atom on the phenyl ring, specifically at the meta position, influences its chemical reactivity and physical properties. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water due to the hydrophobic nature of the cyclopropane and phenyl groups. The carboxylic acid group contributes to its acidity, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the fluorine substituent can enhance the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry. Overall, 1-(3-fluorophenyl)cyclopropanecarboxylic acid is a versatile compound with potential applications in pharmaceuticals and agrochemicals, owing to its unique structural features and functional groups.

Formula: C₁₀H₉FO₂

InChI: InChI=1/C10H9FO2/c11-8-3-1-2-7(6-8)10(4-5-10)9(12)13/h1-3,6H,4-5H2,(H,12,13)

SMILES: c1cc(cc(c1)F)C1(CC1)C(=O)O

Synonyms:

• Cyclopropanecarboxylic Acid, 1-(3-Fluorophenyl)-

Cyclopropanecarboxylic acid, 1-(3-fluorophenyl)-

CAS: 248588-33-2

Formula: C₁₀H₉FO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 180.1757

Ref: IN-DA002PO1

1-(3-Fluoro-phenyl)-cyclopropanecarboxylic acid

CAS: 248588-33-2

1-(3-Fluoro-phenyl)-cyclopropanecarboxylic acid

Purity: 97%

Molecular weight: 180.18g/mol

Ref: 54-PC408075

1-(3-Fluorophenyl)cyclopropane-1-carboxylic acid

CAS: 248588-33-2

Formula: C₁₀H₉FO₂

Purity: 97%

Color and Shape: White crystalline powder

Molecular weight: 180.178

Ref: 10-F044125