CAS 2486-52-4

4-amino-2-bromobenzoic acid

Description:

4-Amino-2-bromobenzoic acid, with the CAS number 2486-52-4, is an aromatic compound characterized by the presence of both an amino group (-NH2) and a bromine atom attached to a benzoic acid structure. This compound features a bromine substituent at the second position and an amino group at the fourth position of the benzene ring, which influences its chemical reactivity and properties. It is typically a solid at room temperature and is soluble in polar solvents due to the carboxylic acid group, while its aromatic nature contributes to its stability. The presence of the amino group allows for potential hydrogen bonding, enhancing its solubility in water. 4-Amino-2-bromobenzoic acid can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it useful in organic synthesis and pharmaceutical applications. Additionally, it may exhibit biological activity, which is of interest in medicinal chemistry. Safety data should be consulted for handling, as with any chemical substance.

Formula: C₇H₆BrNO₂

InChI: InChI=1/C7H6BrNO2/c8-6-3-4(9)1-2-5(6)7(10)11/h1-3H,9H2,(H,10,11)

SMILES: c1cc(c(cc1N)Br)C(=O)O

Benzoic acid, 4-amino-2-bromo-

CAS: 2486-52-4

Formula: C₇H₆BrNO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 216.0320

Ref: IN-DA002POF

4-Amino-2-bromobenzoic acid

CAS: 2486-52-4

4-Amino-2-bromobenzoic acid

Formula: C₇H₆BrNO₂

Purity: ≥95%

Color and Shape: faint orange powder

Molecular weight: 216.03g/mol

Ref: 54-OR400700

4-Amino-2-bromobenzoic acid

CAS: 2486-52-4

Formula: C₇H₆BrNO₂

Purity: 98%

Molecular weight: 216.034

Ref: 10-F443411

2-Bromo-4-aminobenzoic Acid

Controlled Product

CAS: 2486-52-4

Applications 2-Bromo-4-aminobenzoic Acid (cas# 2486-52-4) is a compound useful in organic synthesis.

Formula: C₇H₆BrNO₂

Color and Shape: Light Brown

Molecular weight: 216.03

Ref: TR-B679450