CAS 248607-96-7

2-[(3-Aminopropyl)amino]-4(1H)-quinolinone

Description:

2-[(3-Aminopropyl)amino]-4(1H)-quinolinone, with the CAS number 248607-96-7, is a chemical compound characterized by its quinolinone core structure, which is a bicyclic compound containing a benzene ring fused to a pyridine ring. This compound features an amino group and a propylamine side chain, contributing to its potential biological activity. It is typically a solid at room temperature and may exhibit solubility in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. The compound may possess various pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its structure suggests potential interactions with biological targets, which could be explored in drug discovery research. Additionally, the presence of the amino groups may influence its reactivity and stability, as well as its ability to form salts or complexes with other molecules. Overall, 2-[(3-Aminopropyl)amino]-4(1H)-quinolinone represents a versatile scaffold for further chemical modifications and biological evaluations.

Formula: C₁₂H₁₅N₃O

InChI: InChI=1S/C12H15N3O/c13-6-3-7-14-12-8-11(16)9-4-1-2-5-10(9)15-12/h1-2,4-5,8H,3,6-7,13H2,(H2,14,15,16)

InChI key: InChIKey=MUALRORKNVBJPA-UHFFFAOYSA-N

SMILES: O=C1C=2C(NC(NCCCN)=C1)=CC=CC2

Synonyms:

• 4(1H)-Quinolinone, 2-[(3-aminopropyl)amino]-
• 2-[(3-Aminopropyl)amino]-4(1H)-quinolinone
• 2-[(3-Aminopropyl)amino]-1,4-dihydroquinolin-4-one
• 2-(3-Aminopropan-1-ylamino)-1H-quinolin-4-onediamine