CAS 24868-20-0: 2,4-Imidazolidinedione, 1-[[[5-(4-nitrophenyl)-2-furanyl]methylene]amino]-, sodium salt, hydrate (2:2:7)
Description:2,4-Imidazolidinedione, 1-[[[5-(4-nitrophenyl)-2-furanyl]methylene]amino]-, sodium salt, hydrate (2:2:7) is a complex organic compound characterized by its imidazolidinedione core, which is a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound features a furan ring substituted with a nitrophenyl group, contributing to its potential biological activity and reactivity. The presence of the sodium salt form indicates that it is likely soluble in water, which can enhance its bioavailability in various applications. The hydrate form suggests that it contains water molecules in its crystalline structure, which can influence its stability and solubility. This compound may exhibit properties such as antimicrobial or antifungal activity, making it of interest in pharmaceutical and agricultural research. Its specific interactions and applications would depend on its molecular structure and the functional groups present, which can affect its reactivity and compatibility with other substances. Overall, this compound represents a unique blend of organic chemistry and potential therapeutic applications.
Formula:C14H10N4O5H2O·Na
InChI:InChI=1S/C14H10N4O5.Na.3H2O/c19-13-8-17(14(20)16-13)15-7-11-5-6-12(23-11)9-1-3-10(4-2-9)18(21)22;;;;/h1-7H,8H2,(H,16,19,20);;3*1H2
InChI key:InChIKey=ZOXARHQLZYEIGL-UHFFFAOYSA-N
SMILES:[Na].O=C1NC(=O)CN1N=CC=2OC(=CC2)C=3C=CC(=CC3)N(=O)=O.O
- Synonyms:
- 1-[[5-(p-Nitrophenyl)furfurylidene]amino]hydantoin sodium salt hydrate
- 2,4-Imidazolidinedione, 1-[[[5-(4-nitrophenyl)-2-furanyl]methylene]amino]-, sodium salt, hydrate (2:2:7)
- 2,4-Imidazolidinedione, 1-[[[5-(4-nitrophenyl)-2-furanyl]methylene]amino]-, sodium salt, hydrate (2:7)
- Hydantoin, 1-[[5-(p-nitrophenyl)furfurylidene]amino]-, sodium salt, hydrate (2:7)
- sodium 1-({(E)-[5-(4-nitrophenyl)furan-2-yl]methylidene}amino)-4-oxo-4,5-dihydro-1H-imidazol-2-olate hydrate (2:2:7)