CAS 24871-35-0
:Altronic acid
Description:
Altronic acid, identified by its CAS number 24871-35-0, is a chemical compound that belongs to the class of organic acids. It is characterized by its carboxylic acid functional group, which imparts acidic properties. Altronic acid is typically a white crystalline solid, soluble in water and various organic solvents, making it versatile for different applications. Its molecular structure includes multiple hydroxyl groups, contributing to its reactivity and potential as a chelating agent. The compound may exhibit biological activity, which can be of interest in pharmaceutical and biochemical research. Additionally, altronic acid can participate in various chemical reactions, including esterification and neutralization, making it useful in organic synthesis. While specific physical and chemical properties such as melting point, boiling point, and pH are not detailed here, they can be determined through experimental methods or referenced from chemical databases. Overall, altronic acid is a significant compound in organic chemistry with potential applications in various fields.
Formula:C6H12O7
InChI:InChI=1/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4-,5+/s2
InChI key:InChIKey=RGHNJXZEOKUKBD-IPJFTFHONA-N
SMILES:[C@@H]([C@@H]([C@@H](CO)O)O)([C@@H](C(O)=O)O)O
Synonyms:- Altronic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Altronic acid
CAS:Altronic acid comes from Escherichia coli.Formula:C6H12O7Color and Shape:SolidMolecular weight:196.16
