CAS 2488-53-1
:4-(Difluoromethylsulfonyl)chlorobenzene
Description:
4-(Difluoromethylsulfonyl)chlorobenzene, with the CAS number 2488-53-1, is an organic compound characterized by the presence of a chlorobenzene ring substituted with a difluoromethylsulfonyl group. This compound features a sulfonyl functional group, which is known for its strong electron-withdrawing properties, enhancing its reactivity in various chemical reactions. The difluoromethyl group contributes to its unique properties, including increased lipophilicity and potential applications in medicinal chemistry and agrochemicals. The chlorine atom on the benzene ring adds to the compound's electrophilic character, making it suitable for nucleophilic substitution reactions. Additionally, the presence of fluorine atoms can influence the compound's physical properties, such as boiling point and solubility. Overall, 4-(Difluoromethylsulfonyl)chlorobenzene is a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and specialty chemicals. Safety precautions should be observed when handling this compound due to its potential toxicity and reactivity.
Formula:C7H5ClF2O2S
InChI:InChI=1/C7H5ClF2O2S/c8-5-1-3-6(4-2-5)13(11,12)7(9)10/h1-4,7H
SMILES:c1cc(ccc1Cl)S(=O)(=O)C(F)F
Synonyms:- 1-Chloro-4-[(Difluoromethyl)Sulfonyl]Benzene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-Chloro-4-(difluoromethane)sulfonylbenzene
CAS:1-Chloro-4-(difluoromethane)sulfonylbenzene
Molecular weight:226.62821g/mol


