CAS 2488-54-2

1-chloro-4-[(difluoromethyl)sulfonyl]-2-nitrobenzene

Description:

1-Chloro-4-[(difluoromethyl)sulfonyl]-2-nitrobenzene, with the CAS number 2488-54-2, is an organic compound characterized by its complex structure, which includes a nitro group, a chloro substituent, and a sulfonyl group with a difluoromethyl moiety. This compound typically appears as a solid at room temperature and is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and interactions with other chemical species. The difluoromethyl sulfonyl group enhances its lipophilicity and may improve its biological activity. Additionally, the chlorine atom can provide sites for further chemical modifications. Safety data indicates that, like many halogenated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, 1-chloro-4-[(difluoromethyl)sulfonyl]-2-nitrobenzene is a compound of interest for its unique chemical properties and potential utility in synthetic chemistry.

Formula: C₇H₄ClF₂NO₄S

InChI: InChI=1/C7H4ClF2NO4S/c8-5-2-1-4(3-6(5)11(12)13)16(14,15)7(9)10/h1-3,7H

SMILES: c1cc(c(cc1S(=O)(=O)C(F)F)N(=O)=O)Cl

1-chloro-4-[(difluoromethyl)sulphonyl]-2-nitrobenzene

CAS: 2488-54-2

1-chloro-4-[(difluoromethyl)sulphonyl]-2-nitrobenzene

Purity: ≥95%

Molecular weight: 271.63g/mol

Ref: 54-PC32172

1-Chloro-4-difluoromethanesulfonyl-2-nitrobenzene

CAS: 2488-54-2

Versatile small molecule scaffold

Formula: C₇H₄ClF₂NO₄S

Purity: Min. 95%

Molecular weight: 271.63 g/mol

Ref: 3D-CAA48854