CAS 24880-48-6
:(7Z)-7-Hexadecen-1-ol
Description:
(7Z)-7-Hexadecen-1-ol, with the CAS number 24880-48-6, is a long-chain unsaturated fatty alcohol characterized by its specific molecular structure, which includes a 16-carbon chain with a double bond located at the seventh carbon from the terminal end. This compound is typically found in various natural sources, including certain plant oils and animal fats. It exhibits properties common to fatty alcohols, such as being hydrophobic and having a relatively high boiling point due to its long carbon chain. The presence of the double bond contributes to its reactivity, making it useful in various chemical applications, including as an intermediate in the synthesis of surfactants, emulsifiers, and other organic compounds. Additionally, (7Z)-7-Hexadecen-1-ol may possess biological activity, potentially influencing processes such as cell signaling or acting as a pheromone in certain organisms. Its physical properties, such as solubility and melting point, can vary depending on the specific conditions and the presence of other substances.
Formula:C16H32O
InChI:InChI=1S/C16H32O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17/h9-10,17H,2-8,11-16H2,1H3/b10-9-
InChI key:InChIKey=KKGMASVOOYPIGJ-KTKRTIGZSA-N
SMILES:C(\CCCCCCCC)=C\CCCCCCO
Synonyms:- (7Z)-7-Hexadecen-1-ol
- (7Z)-hexadec-7-en-1-ol
- (Z)-7-Hexadecen-1-ol
- (Z)-7-Hexadecenol
- (Z)-7-Hexadecenyl alcohol
- 7-Hexadecen-1-ol, (7Z)-
- 7-Hexadecen-1-ol, (Z)-
- Ai3-35163
- Ent 35163
- Hypogeyl alcohol
- cis-7-Hexadecen-1-ol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(Z)-7-Hexadecenol
CAS:Controlled ProductApplications (Z)-7-Hexadecenol is an derivative of essential oils with potential antibacterial activities.
References Xiong, L., et al.: Molecules., 18, 963 (2013);Formula:C16H32OColor and Shape:NeatMolecular weight:240.42(Z)-7-Hexadecenol
CAS:(Z)-7-Hexadecenol is an analog of a protein found in human urine that has been shown to have anticancer properties. It induces apoptosis, or programmed cell death, in cancer cells by inhibiting the activity of cyclin-dependent kinases (CDKs), which are enzymes involved in cell division. This inhibition leads to a decrease in cell proliferation and an increase in tumor cell death. (Z)-7-Hexadecenol has been studied as a potential inhibitor for various types of cancer, including breast, lung, and colon cancer. In Chinese hamster ovary cells, this compound has demonstrated potent anticancer activity by inhibiting the growth of cancer cells. The use of (Z)-7-Hexadecenol as a potential cancer treatment is still under investigation and requires further research.Formula:C16H32OPurity:Min. 95%Molecular weight:240.42 g/mol


