CAS 24891-35-8
:N-(3-hydroxyphenyl)formamide
Description:
N-(3-hydroxyphenyl)formamide, with the CAS number 24891-35-8, is an organic compound characterized by the presence of a formamide functional group attached to a phenolic ring. This compound features a hydroxyl group (-OH) positioned at the meta position relative to the amide group, which influences its chemical reactivity and solubility. It typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the hydroxyl group, which can engage in hydrogen bonding. The compound may exhibit biological activity, making it of interest in medicinal chemistry and research. Its structure allows for potential interactions with various biological targets, and it may participate in reactions typical of both amides and phenolic compounds. Additionally, N-(3-hydroxyphenyl)formamide can serve as a precursor or intermediate in the synthesis of more complex organic molecules. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose health risks if not managed properly.
Formula:C7H7NO2
InChI:InChI=1/C7H7NO2/c9-5-8-6-2-1-3-7(10)4-6/h1-5,10H,(H,8,9)
SMILES:c1cc(cc(c1)O)N=CO
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-(3-Hydroxyphenyl)formamide
CAS:N-(3-Hydroxyphenyl)formamide is a compound that has shown activity in liver microsomes. It has been found to inhibit the enzyme 3-kinase, which plays a role in various cellular signaling pathways. N-(3-Hydroxyphenyl)formamide is also known for its presence in pyrazine, a heterocyclic compound commonly used in the synthesis of pharmaceuticals and flavorings. Additionally, this compound has been studied for its potential interactions with cardiac glycosides, dopamine, and other neurotransmitters. N-(3-Hydroxyphenyl)formamide exhibits water-solubility and can form complexes with aluminum and benzoate ions. Its chemical structure contains an oxindole moiety, making it a subject of interest in the field of research chemicals.Formula:C7H7NO2Purity:Min. 95%Molecular weight:137.14 g/mol
