CAS 2490-53-1
:methyl 2-methylhexadecanoate
Description:
Methyl 2-methylhexadecanoate, with the CAS number 2490-53-1, is an ester derived from the fatty acid 2-methylhexadecanoic acid and methanol. This compound is characterized by its long carbon chain, which typically imparts hydrophobic properties, making it less soluble in water but more soluble in organic solvents. It has a relatively high molecular weight due to the lengthy hydrocarbon chain, contributing to its potential use in various applications, including as a flavoring agent, fragrance, or in the formulation of personal care products. The presence of the methyl group at the second carbon position of the hexadecanoate chain can influence its physical properties, such as melting and boiling points, as well as its reactivity. Methyl esters like this one are often studied for their potential as biodiesel feedstocks due to their renewable nature and favorable combustion properties. Additionally, they may exhibit low toxicity and biodegradability, making them environmentally friendly alternatives in various industrial applications.
Formula:C18H36O2
InChI:InChI=1/C18H36O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18(19)20-3/h17H,4-16H2,1-3H3
SMILES:CCCCCCCCCCCCCCC(C)C(=O)OC
Synonyms:- Hexadecanoic acid, 2-methyl-, methyl ester
- Methyl 2-methylhexadecanoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
DL-α-Methylpalmitic acid methyl ester
CAS:DL-alpha-Methylpalmitic acid methyl ester is a geometric isomer of the fatty acid alpha-methylpalmitic acid. It is used as a research chemical and has been shown to have an inhibitory effect on chlorophytum plants. This compound also has health effects on humans, such as lipid profiles and biochemical parameters, which are dependent on the degree of unsaturation. DL-alpha-Methylpalmitic acid methyl ester can be synthesized from fatty acids by ethylating with alcohols or ethyl esters. The synthesis of this compound can be achieved by using a chromatographic method that separates the desired product from other molecules in a mixture.Formula:C18H36O2Purity:Min. 95%Color and Shape:PowderMolecular weight:284.48 g/molDL-α-Methylpalmitic acid methyl ester
CAS:DL-alpha-Methylpalmitic acid methyl ester is a chemical that can be used as a reaction component, reagent, and intermediate. It has been shown to have many useful applications in the synthesis of complex compounds, including pharmaceuticals. DL-alpha-Methylpalmitic acid methyl ester is a versatile building block with many applications in organic synthesis, such as coupling reactions or condensations.Formula:C18H36O2Molecular weight:284.49 g/mol
