CAS 24906-76-1

3-[(Difluoromethyl)sulfonyl]benzenamine

Description:

3-[(Difluoromethyl)sulfonyl]benzenamine, with the CAS number 24906-76-1, is an organic compound characterized by the presence of a sulfonyl group attached to a difluoromethyl moiety and an aniline structure. This compound features a benzene ring substituted at the meta position with a sulfonamide functional group, which enhances its reactivity and solubility in polar solvents. The difluoromethyl group contributes to its unique electronic properties, potentially influencing its behavior in chemical reactions and interactions with biological systems. The sulfonyl group is known for its ability to participate in various chemical transformations, making this compound of interest in synthetic organic chemistry and medicinal chemistry. Additionally, the presence of fluorine atoms can impart distinct characteristics such as increased lipophilicity and metabolic stability. Overall, 3-[(Difluoromethyl)sulfonyl]benzenamine is a versatile compound that may find applications in pharmaceuticals, agrochemicals, and materials science due to its unique structural features and reactivity.

Formula: C₇H₇F₂NO₂S

InChI: InChI=1S/C7H7F2NO2S/c8-7(9)13(11,12)6-3-1-2-5(10)4-6/h1-4,7H,10H2

InChI key: InChIKey=FCOOMKBBMQXONN-UHFFFAOYSA-N

SMILES: S(C(F)F)(=O)(=O)C1=CC(N)=CC=C1

Synonyms:

• 3-Difluoromethanesulfonylaniline
• Benzenamine, 3-[(difluoromethyl)sulfonyl]-
• Aniline, m-[(difluoromethyl)sulfonyl]-
• 3-[(Difluoromethyl)sulfonyl]benzenamine
• 3-(Difluoromethylsulfonyl)aniline

3-difluoromethanesulfonylaniline

CAS: 24906-76-1

Formula: C₇H₇F₂NO₂S

Molecular weight: 207.1978

Ref: IN-DA003AWD