CAS 24910-11-0

3,9-diazaspiro[5.5]undecane-2,4-dione

Description:

3,9-Diazaspiro[5.5]undecane-2,4-dione is a bicyclic compound characterized by its unique spiro structure, which consists of two nitrogen atoms incorporated into a larger carbon framework. This compound features a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential applications in organic synthesis. The spiro configuration provides distinct steric and electronic properties, making it an interesting subject for research in medicinal chemistry and materials science. The presence of nitrogen atoms in the structure can enhance its solubility and influence its biological activity. Additionally, the compound may exhibit various tautomeric forms due to the keto-enol equilibrium associated with the dione functionality. Its CAS number, 24910-11-0, allows for easy identification in chemical databases and literature. Overall, 3,9-diazaspiro[5.5]undecane-2,4-dione is a compound of interest due to its structural complexity and potential applications in various fields of chemistry.

Formula: C₉H₁₄N₂O₂

InChI: InChI=1/C9H14N2O2/c12-7-5-9(6-8(13)11-7)1-3-10-4-2-9/h10H,1-6H2,(H,11,12,13)

SMILES: C1CNCCC21CC(=NC(=O)C2)O

Synonyms:

• 3,9-Diazaspiro[5.5]undecan-2,4-dion

3,9-Diazaspiro[5.5]undecane-2,4-dione

CAS: 24910-11-0

Formula: C₉H₁₄N₂O₂

Molecular weight: 182.2197

Ref: IN-DA002PV8

3,9-Diazaspiro[5.5]undecane-2,4-dione

CAS: 24910-11-0

3,9-Diazaspiro[5.5]undecane-2,4-dione

Purity: ≥95%

Molecular weight: 182.22g/mol

Ref: 54-OR306454