CAS 24915-04-6

(7S,7aS,14S,14aS)-Dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocine

Description:

(7S,7aS,14S,14aS)-Dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocine, with CAS number 24915-04-6, is a complex organic compound characterized by its unique bicyclic structure that incorporates nitrogen atoms within its rings. This compound features a fused bicyclic system, which contributes to its rigidity and potential biological activity. The stereochemistry indicated by the (7S,7aS,14S,14aS) configuration suggests specific spatial arrangements of its substituents, which can significantly influence its chemical reactivity and interactions with biological targets. The presence of multiple nitrogen atoms in the structure may impart basic properties, allowing for potential interactions with acids or other electrophiles. Additionally, the compound's dodecahydro designation indicates a fully saturated framework, which typically enhances stability and reduces reactivity compared to unsaturated analogs. Overall, this compound's intricate structure and stereochemistry make it of interest in fields such as medicinal chemistry and pharmacology, where it may serve as a lead compound for further development.

Formula: C₁₅H₂₆N₂

InChI: InChI=1S/C15H26N2/c1-3-7-16-11-13-9-12(14(16)5-1)10-17-8-4-2-6-15(13)17/h12-15H,1-11H2/t12-,13-,14-,15-/m0/s1

InChI key: InChIKey=SLRCCWJSBJZJBV-AJNGGQMLSA-N

SMILES: [C@@]12([C@]3(N(C[C@](C1)([C@]4(N(C2)CCCC4)[H])[H])CCCC3)[H])[H]

Synonyms:

• β-Isosparteine
• β-Sparteine
• 7,14-Methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocine, dodecahydro-, (7S,7aS,14S,14aS)-
• (7S,7aS,14S,14aS)-Dodecahydro-7,14-methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocine
• 7,14-Methano-2H,6H-dipyrido[1,2-a:1′,2′-e][1,5]diazocine, dodecahydro-, [7S-(7α,7aβ,14α,14aβ)]-

β-Sparteine

CAS: 24915-04-6

Sparteine: Class 1a antiarrhythmic, Na+ channel blocker. Poor metabolizers lack P-450IID1, impeding debrisoquine hydroxylation.

Formula: C₁₅H₂₆N₂

Color and Shape: Solid

Molecular weight: 234.38

Ref: TM-TMA2106

(-)-Sparteine

CAS: 24915-04-6

(-)-Sparteine is an alkaloid compound, which is naturally sourced from the genus *Cytisus* in the family Fabaceae. It is particularly found in the seeds of the Scotch broom (*Cytisus scoparius*). The mode of action of (-)-Sparteine is predominately as a chiral ligand, making it valuable in asymmetric synthesis. It forms complexes with metals, influencing the stereo-outcome of various chemical reactions by providing a chiral environment.

Formula: C₁₅H₂₆N₂

Purity: Min. 95%

Molecular weight: 234.38 g/mol

Ref: 3D-ZAA91504