CAS 24933-57-1

4-(Difluoromethylthio)nitrobenzene

Description:

4-(Difluoromethylthio)nitrobenzene is an organic compound characterized by the presence of a nitro group and a difluoromethylthio substituent on a benzene ring. Its molecular structure features a benzene ring with a nitro group (-NO2) attached to one carbon and a difluoromethylthio group (-CF2SH) attached to the para position relative to the nitro group. This compound is typically a pale yellow solid at room temperature and is known for its potential applications in organic synthesis and as an intermediate in the production of various pharmaceuticals and agrochemicals. The difluoromethylthio group imparts unique electronic and steric properties, influencing the compound's reactivity and interactions. Additionally, the presence of both electronegative fluorine atoms and the nitro group contributes to its overall polarity and may affect its solubility in different solvents. Safety precautions should be taken when handling this compound, as it may pose health risks due to its chemical nature.

Formula: C₇H₅F₂NO₂S

InChI: InChI=1/C7H5F2NO2S/c8-7(9)13-6-3-1-5(2-4-6)10(11)12/h1-4,7H

SMILES: c1cc(ccc1N(=O)=O)SC(F)F

Synonyms:

• 1-[(Difluoromethyl)Sulfanyl]-4-Nitrobenzene

4-(Difluoromethylthio)nitrobenzene

CAS: 24933-57-1

Formula: C₇H₅F₂NO₂S

Purity: 95%

Color and Shape: Liquid

Molecular weight: 205.1819

Ref: IN-DA00BGI3

4-[(Difluoromethyl)thio]nitrobenzene

CAS: 24933-57-1

4-[(Difluoromethyl)thio]nitrobenzene

Purity: 99%

Molecular weight: 205.18g/mol

Ref: 54-PC50139

(Difluoromethyl)(4-nitrophenyl)sulfane

CAS: 24933-57-1

Purity: 95%

Color and Shape: Liquid

Molecular weight: 205.1799927

Ref: 10-F602270