CAS 24933-58-2

2-[(difluoromethyl)sulfanyl]aniline

Description:

2-[(Difluoromethyl)sulfanyl]aniline, with the CAS number 24933-58-2, is an organic compound characterized by the presence of both an aniline group and a difluoromethylthio substituent. This compound features a sulfur atom bonded to a difluoromethyl group, which contributes to its unique reactivity and properties. The difluoromethyl group is known for its electron-withdrawing effects, which can influence the compound's acidity and nucleophilicity. The aniline portion of the molecule provides basicity due to the amino group, making it capable of participating in various chemical reactions, including electrophilic aromatic substitution. The presence of fluorine atoms enhances the compound's stability and lipophilicity, potentially affecting its solubility in organic solvents. Additionally, the compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Overall, 2-[(difluoromethyl)sulfanyl]aniline is a versatile compound with potential applications in organic synthesis and medicinal chemistry.

Formula: C₇H₇F₂NS

InChI: InChI=1/C7H7F2NS/c8-7(9)11-6-4-2-1-3-5(6)10/h1-4,7H,10H2

SMILES: c1ccc(c(c1)N)SC(F)F

Synonyms:

• 2-[(Difluoromethyl)Thio]Aniline

2-[(Difluoromethyl)thio]aniline

CAS: 24933-58-2

Formula: C₇H₇F₂NS

Purity: 95.0%

Molecular weight: 175.2

Ref: 10-F521171