CymitQuimica logo

CAS 24933-59-3

:

3-(difluoromethylsulfanyl)aniline

Description:
3-(Difluoromethylsulfanyl)aniline, with the CAS number 24933-59-3, is an organic compound characterized by the presence of an aniline moiety substituted with a difluoromethylsulfanyl group at the meta position. This compound features a benzene ring bonded to an amino group (-NH2) and a difluoromethylsulfanyl group (-SF2), which contributes to its unique chemical properties. The difluoromethylsulfanyl group enhances the compound's reactivity and may influence its solubility and stability in various solvents. The presence of fluorine atoms typically imparts increased electronegativity, which can affect the compound's interaction with other molecules. Additionally, the sulfonyl group can enhance the compound's potential as a building block in pharmaceuticals or agrochemicals due to its ability to participate in various chemical reactions. Overall, 3-(difluoromethylsulfanyl)aniline is of interest in synthetic chemistry and materials science, where its unique functional groups can be leveraged for diverse applications.
Formula:C7H7F2NS
InChI:InChI=1/C7H7F2NS/c8-7(9)11-6-3-1-2-5(10)4-6/h1-4,7H,10H2
SMILES:c1cc(cc(c1)SC(F)F)N
Synonyms:
  • 3-[(Difluoromethyl)sulfanyl]aniline
  • Benzenamine, 3-[(difluoromethyl)thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.