CAS 24939-17-1

1-(4-Hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione

Description:

1-(4-Hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione, with CAS number 24939-17-1, is a synthetic organic compound characterized by its complex structure featuring multiple functional groups, including hydroxyl and methoxy groups. This compound belongs to the class of polyphenolic compounds and is known for its potential antioxidant properties. The presence of the diene and diketone functionalities contributes to its reactivity and ability to participate in various chemical reactions, including those involving radical scavenging. The hydroxyl groups enhance its solubility in polar solvents and may contribute to its biological activity. Additionally, the compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of therapeutic agents due to its bioactive properties. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it an interesting subject for further research in medicinal chemistry and material science.

Formula: C₂₀H₁₈O₅

InChI: InChI=1S/C20H18O5/c1-25-20-12-15(6-11-19(20)24)5-10-18(23)13-17(22)9-4-14-2-7-16(21)8-3-14/h2-12,21,24H,13H2,1H3

InChI key: InChIKey=HJTVQHVGMGKONQ-UHFFFAOYSA-N

SMILES: C(=CC(CC(C=CC1=CC=C(O)C=C1)=O)=O)C2=CC(OC)=C(O)C=C2

Synonyms:

• (1E,6E)-1-(4-Hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione
• (p-Hydroxycinnamoyl)feruloylmethane
• 1,6-Heptadiene-3,5-Dione, 1-(4-Hydroxy-3-Methoxyphenyl)-7-(4-Hydroxyphenyl)-
• 1,6-Heptadiene-3,5-dione, 1-(4-hydroxy-3-methoxyphenyl)-7-(p-hydroxyphenyl)-
• 1,6-heptadiene-3,5-dione, 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-, (1E,6E)-
• 1-(4-Hydroxy-3-Methoxyphenyl)-7-(4-Hydroxyphenyl)Hepta-1,6-Diene-3,5-Dione
• 1-(4-Hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione

1,6-Heptadiene-3,5-dione, 1-(4-hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-

CAS: 24939-17-1

Formula: C₂₀H₁₈O₅

Purity: 95%

Color and Shape: Solid

Molecular weight: 338.3539

Ref: IN-DA002PXG

1-(4-Hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione

CAS: 24939-17-1

1-(4-Hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)hepta-1,6-diene-3,5-dione

Purity: 98%

Molecular weight: 338.35g/mol

Ref: 54-OR1024416

(E/Z)-Demethoxycurcumin

CAS: 24939-17-1

(E/Z)-Demethoxycurcumin

Purity: ≥98%

Molecular weight: 338.35g/mol

Ref: 54-BUP04243

Desmethoxy Curcumin

CAS: 24939-17-1

Formula: C₂₀H₁₈O₅

Molecular weight: 338.36

Ref: 4Z-C-699

(E/Z)-Demethoxycurcumin

CAS: 24939-17-1

(p-Hydroxycinnamoyl)feruloylmethane is found in Curcuma zedoaria and Etlingera elatior.

Formula: C₂₀H₁₈O₅

Purity: 98.76%

Color and Shape: Solid

Molecular weight: 338.35

Ref: TM-T4803

1-(4-Hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione

CAS: 24939-17-1

1-(4-Hydroxy-3-methoxyphenyl)-7-(4-hydroxyphenyl)-1,6-heptadiene-3,5-dione is commonly known as Curcumin, a polyphenolic compound derived from the rhizome of the plant Curcuma longa, commonly known as turmeric. It is a natural product with a diverse range of biological activities. Curcumin is known for its antioxidant properties, which enable it to scavenge free radicals and reduce oxidative stress. Furthermore, it exhibits anti-inflammatory effects by inhibiting various molecules involved in the inflammatory pathway, such as NF-κB and COX-2 enzymes.

Formula: C₂₀H₁₈O₅

Purity: Min. 95%

Molecular weight: 338.35 g/mol

Ref: 3D-FD73796