CymitQuimica logo

CAS 2495-79-6

:

3-[4-(benzyloxy)-5-methoxy-2-nitrophenyl]-2-oxopropanoic acid

Description:
3-[4-(Benzyloxy)-5-methoxy-2-nitrophenyl]-2-oxopropanoic acid, with the CAS number 2495-79-6, is an organic compound characterized by its complex structure that includes a propanoic acid moiety and multiple functional groups. The presence of a benzyloxy group and a methoxy group indicates that the compound has aromatic characteristics, contributing to its potential reactivity and solubility properties. The nitro group introduces electron-withdrawing characteristics, which can influence the compound's acidity and reactivity in various chemical reactions. This compound may exhibit biological activity due to its structural features, making it of interest in medicinal chemistry and drug development. Its solubility in organic solvents and potential interactions with biological targets can be explored for applications in pharmaceuticals. Additionally, the presence of multiple substituents on the aromatic ring suggests that it may undergo various substitution reactions, making it a versatile compound for further chemical modifications. Overall, this compound's unique structural attributes position it as a candidate for research in both synthetic and medicinal chemistry.
Formula:C17H15NO7
InChI:InChI=1/C17H15NO7/c1-24-15-8-12(7-14(19)17(20)21)13(18(22)23)9-16(15)25-10-11-5-3-2-4-6-11/h2-6,8-9H,7,10H2,1H3,(H,20,21)
SMILES:COc1cc(CC(=O)C(=O)O)c(cc1OCc1ccccc1)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.