CAS 2495-80-9
:5-hydroxy-6-methoxy-1H-indole-2-carboxylic acid
Description:
5-Hydroxy-6-methoxy-1H-indole-2-carboxylic acid, also known by its CAS number 2495-80-9, is an indole derivative characterized by the presence of hydroxyl and methoxy functional groups, as well as a carboxylic acid moiety. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents due to its functional groups. It is known for its potential biological activities, including antioxidant properties and possible roles in various biochemical pathways. The indole structure is significant in medicinal chemistry, often serving as a scaffold for drug development. The presence of the hydroxyl and methoxy groups can influence the compound's reactivity, solubility, and interaction with biological targets. Additionally, this compound may be of interest in research related to neurochemistry and pharmacology, given the importance of indole derivatives in neurotransmitter synthesis and function. Overall, 5-hydroxy-6-methoxy-1H-indole-2-carboxylic acid represents a valuable compound for further study in both synthetic and medicinal chemistry contexts.
Formula:C10H9NO4
InChI:InChI=1/C10H9NO4/c1-15-9-4-6-5(3-8(9)12)2-7(11-6)10(13)14/h2-4,11-12H,1H3,(H,13,14)
SMILES:COc1cc2c(cc(C(=O)O)[nH]2)cc1O
Synonyms:- 1H-indole-2-carboxylic acid, 5-hydroxy-6-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
1H-Indole-2-carboxylic acid, 5-hydroxy-6-methoxy-
CAS:Formula:C10H9NO4Purity:98%Molecular weight:207.18285-Hydroxy-6-methoxy-1H-indole-2-carboxylic acid
CAS:5-Hydroxy-6-methoxy-1H-indole-2-carboxylic acidPurity:97%Molecular weight:207.18g/mol5-Hydroxy-6-methoxyindole-carboxylic acid
CAS:<p>5-Hydroxy-6-methoxyindole-carboxylic acid (5-HMICA) is a molecule that is found in the pericardium and urine of patients with cancer. 5-HMICA has been shown to suppress tumor growth and activate cell mediated cytotoxicity in vitro. It also induces T helper type 1 (Th1) immune responses, which are associated with the production of cytokines such as interferon gamma and tumor necrosis factor alpha.</p>Formula:C10H9NO4Color and Shape:PowderMolecular weight:207.18 g/mol



