CymitQuimica logo

CAS 2495-80-9

:

5-hydroxy-6-methoxy-1H-indole-2-carboxylic acid

Description:
5-Hydroxy-6-methoxy-1H-indole-2-carboxylic acid, also known by its CAS number 2495-80-9, is an indole derivative characterized by the presence of hydroxyl and methoxy functional groups, as well as a carboxylic acid moiety. This compound typically exhibits a solid state at room temperature and is soluble in polar solvents due to its functional groups. It is known for its potential biological activities, including antioxidant properties and possible roles in various biochemical pathways. The indole structure is significant in medicinal chemistry, often serving as a scaffold for drug development. The presence of the hydroxyl and methoxy groups can influence the compound's reactivity, solubility, and interaction with biological targets. Additionally, this compound may be of interest in research related to neurochemistry and pharmacology, given the importance of indole derivatives in neurotransmitter synthesis and function. Overall, 5-hydroxy-6-methoxy-1H-indole-2-carboxylic acid represents a valuable compound for further study in both synthetic and medicinal chemistry contexts.
Formula:C10H9NO4
InChI:InChI=1/C10H9NO4/c1-15-9-4-6-5(3-8(9)12)2-7(11-6)10(13)14/h2-4,11-12H,1H3,(H,13,14)
InChI key:FWKJNOVLYWGWCH-UHFFFAOYSA-N
SMILES:COc1cc2c(cc(C(=O)O)[nH]2)cc1O
Synonyms:
  • 1H-indole-2-carboxylic acid, 5-hydroxy-6-methoxy-
Found 5 products.