CAS 2495-92-3
:6-benzyloxy-5-methoxy-2-carboxyindole
Description:
6-Benzyloxy-5-methoxy-2-carboxyindole is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This particular compound features a benzyloxy group and a methoxy group, which contribute to its unique chemical properties and potential biological activities. The presence of the carboxylic acid functional group enhances its solubility in polar solvents and may influence its reactivity and interaction with biological systems. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the indole core's prevalence in biologically active compounds. Additionally, the presence of substituents like the benzyloxy and methoxy groups can modulate the compound's pharmacokinetic properties, such as absorption and metabolism. Overall, 6-benzyloxy-5-methoxy-2-carboxyindole is of interest for its potential therapeutic applications, although further studies would be necessary to fully elucidate its biological activity and mechanisms of action.
Formula:C17H15NO4
InChI:InChI=1/C17H15NO4/c1-21-15-8-12-7-14(17(19)20)18-13(12)9-16(15)22-10-11-5-3-2-4-6-11/h2-9,18H,10H2,1H3,(H,19,20)
SMILES:COc1cc2cc(C(=O)O)[nH]c2cc1OCc1ccccc1
Synonyms:- 6-Benzyloxy-5-methoxyindole-2-carboxylic Acid
- 6-(benzyloxy)-5-methoxy-1H-indole-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1H-Indole-2-carboxylic acid, 5-methoxy-6-(phenylmethoxy)-
CAS:Formula:C17H15NO4Purity:95%Color and Shape:SolidMolecular weight:297.30536-(Benzyloxy)-5-methoxy-1H-indole-2-carboxylic acid
CAS:6-(Benzyloxy)-5-methoxy-1H-indole-2-carboxylic acidPurity:≥95%Color and Shape:SolidMolecular weight:297.31g/mol6-Benzyloxy-5-methoxy-1H-indole-2-carboxylic acid
CAS:Purity:95.0%Molecular weight:297.309997558593756-Benzyloxy-5-methoxyindole-2-carboxylic Acid
CAS:Controlled Product<p>Applications 6-Benzyloxy-5-methoxyindole-2-carboxylic Acid (cas# 2495-92-3) is a compound useful in organic synthesis.<br>References J. Heterocyclic Chem., 2, 387 (1965)<br></p>Formula:C17H15NO4Color and Shape:Beige To Light BrownMolecular weight:297.316-Benzyloxy-5-methoxyindole-2-carboxylic acid
CAS:<p>Please enquire for more information about 6-Benzyloxy-5-methoxyindole-2-carboxylic acid including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C17H15NO4Purity:Min. 95%Molecular weight:297.31 g/mol





