CAS 24955-29-1
:Z-Phe-Leu-Ala-OH
Description:
Z-Phe-Leu-Ala-OH, also known as Z-Phenylalanine-Leucine-Alanine-OH, is a synthetic peptide that consists of three amino acids: phenylalanine (Phe), leucine (Leu), and alanine (Ala), with a protective Z (benzyloxycarbonyl) group on the phenylalanine residue. This protective group enhances the stability and solubility of the peptide during synthesis and storage. The CAS number 24955-29-1 identifies this specific compound in chemical databases. Peptides like Z-Phe-Leu-Ala-OH are often used in biochemical research and pharmaceutical applications due to their potential roles in biological processes, such as signaling and enzyme activity modulation. The presence of hydrophobic amino acids like leucine can influence the peptide's conformation and interactions with biological membranes. Additionally, the Z group can be removed under specific conditions, allowing for further functionalization or incorporation into larger peptide chains. Overall, Z-Phe-Leu-Ala-OH serves as a valuable building block in peptide synthesis and research.
Formula:C26H33N3O6
InChI:InChI=1/C26H33N3O6/c1-17(2)14-21(23(30)27-18(3)25(32)33)28-24(31)22(15-19-10-6-4-7-11-19)29-26(34)35-16-20-12-8-5-9-13-20/h4-13,17-18,21-22H,14-16H2,1-3H3,(H,27,30)(H,28,31)(H,29,34)(H,32,33)
SMILES:CC(C)CC(C(=NC(C)C(=O)O)O)N=C(C(Cc1ccccc1)N=C(O)OCc1ccccc1)O
Synonyms:- N-[(benzyloxy)carbonyl]phenylalanylleucylalanine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Z-Phe-Leu-Ala-OH
CAS:Z-Phe-Leu-Ala-OH is a homologous protein that has been shown to have proteolytic activity. It has a neutral pH and is stable in the presence of metal ions. This enzyme is structurally similar to subtilisin, with a sequence of residues containing two histidine residues, which are important for stability. The kinetic parameters of this enzyme were determined by analyzing its activity under different conditions and at different temperatures. The mutant Z-Phe-Leu-Ala-OH was found to be more active than the wild type at high temperature, but less active at low temperature, suggesting that the protein could be used as an industrial catalyst in food processing or chemical production.
Formula:C26H33N3O6Purity:Min. 95%Molecular weight:483.56 g/molRef: 3D-FP111552
Discontinued product
