CAS 24955-29-1: Z-Phe-Leu-Ala-OH
Description:Z-Phe-Leu-Ala-OH, also known as Z-Phenylalanine-Leucine-Alanine-OH, is a synthetic peptide that consists of three amino acids: phenylalanine (Phe), leucine (Leu), and alanine (Ala), with a protective Z (benzyloxycarbonyl) group on the phenylalanine residue. This protective group enhances the stability and solubility of the peptide during synthesis and storage. The CAS number 24955-29-1 identifies this specific compound in chemical databases. Peptides like Z-Phe-Leu-Ala-OH are often used in biochemical research and pharmaceutical applications due to their potential roles in biological processes, such as signaling and enzyme activity modulation. The presence of hydrophobic amino acids like leucine can influence the peptide's conformation and interactions with biological membranes. Additionally, the Z group can be removed under specific conditions, allowing for further functionalization or incorporation into larger peptide chains. Overall, Z-Phe-Leu-Ala-OH serves as a valuable building block in peptide synthesis and research.
Formula:C26H33N3O6
InChI:InChI=1/C26H33N3O6/c1-17(2)14-21(23(30)27-18(3)25(32)33)28-24(31)22(15-19-10-6-4-7-11-19)29-26(34)35-16-20-12-8-5-9-13-20/h4-13,17-18,21-22H,14-16H2,1-3H3,(H,27,30)(H,28,31)(H,29,34)(H,32,33)
- Synonyms:
- N-[(benzyloxy)carbonyl]phenylalanylleucylalanine
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | Z-Phe-Leu-Ala-OH REF: 3D-FP111552CAS: 24955-29-1 | Min. 95% | 349.00 €~3,065.00 € | Tue 10 Jun 25 |

Z-Phe-Leu-Ala-OH
Ref: 3D-FP111552
1g | 894.00 € | ||
2g | 1,451.00 € | ||
5g | 3,065.00 € | ||
250mg | 349.00 € | ||
500mg | 544.00 € |