CAS 24958-42-7: 2-Bromo-4-methoxy-5-(phenylmethoxy)benzoic acid
Description:2-Bromo-4-methoxy-5-(phenylmethoxy)benzoic acid is an organic compound characterized by its complex structure, which includes a benzoic acid moiety substituted with a bromine atom, a methoxy group, and a phenylmethoxy group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The methoxy groups enhance the compound's solubility in organic solvents and can also affect its electronic properties, potentially making it a candidate for various chemical reactions, including nucleophilic substitutions. The phenylmethoxy group adds steric bulk and can influence the compound's interactions with biological targets, making it of interest in medicinal chemistry. This compound may exhibit specific physical properties such as melting point and solubility, which are influenced by its functional groups and overall molecular structure. Additionally, its unique combination of substituents may impart interesting biological activities, warranting further investigation in pharmacological studies. Overall, 2-Bromo-4-methoxy-5-(phenylmethoxy)benzoic acid represents a versatile structure in organic synthesis and medicinal chemistry.
Formula:C15H13BrO4
InChI:InChI=1S/C15H13BrO4/c1-19-13-8-12(16)11(15(17)18)7-14(13)20-9-10-5-3-2-4-6-10/h2-8H,9H2,1H3,(H,17,18)
InChI key:InChIKey=FBTDEMXQQIWHKX-UHFFFAOYSA-N
SMILES:O=C(O)C=1C=C(OCC=2C=CC=CC2)C(OC)=CC1Br
- Synonyms:
- 2-Bromo-4-Methoxy-5-(Phenylmethoxy)Benzoic Acid
- 2-Bromo-5-Benzyloxy-4-Methoxybenzoic Acid
- 2-Brono-5-Benzyloxy-4-Methoxybenzoic Acid
- 3-Benzyloxy-4-methoxy-6-bromoben
- 3-Benzyloxy-4-methoxy-6-bromobenzoic acid
- 3-Bromo-4-Methoxy-5-Benzyloxybenzoic Acid
- 5-(Benzyloxy)-2-Bromo-4-Methoxybenzoic Acid
- 5-Benzyloxy-2-Bromo-4-Methoxy-Benzoic Acid
- 5-Benzyloxy-2-Bromo-4-Methoxyb
- Benzoic acid, 2-bromo-4-methoxy-5-(phenylmethoxy)-
- See more synonyms
- Benzoic acid, 5-(benzyloxy)-2-bromo-4-methoxy-
- 5-(Benzyloxy)-2-bromo-p-anisic acid (COOH=1)
- 2-BROMO-4-METHOXY-5-(BENZYLOXY)BENZOIC ACID
- 5-BENZOYLOXY-2-BROMO-4-METHOXYBENZOIC ACID
- 5-Benzyl-2-bromo-4-methoxylbenzoic acid

5-Benzyloxy-2-bromo-4-methoxybenzoic Acid
Ref: 3B-B3332
1g | 92.00 € | ||
5g | 341.00 € |

Benzoic acid, 2-bromo-4-methoxy-5-(phenylmethoxy)-
Ref: IN-DA002PZE
1g | 86.00 € | ||
5g | 197.00 € |

2-Bromo-4-methoxy-5-(benzyloxy)benzoic acid
Ref: 10-F221681
1g | To inquire | ||
5g | To inquire |

2-Bromo-5-benzyloxy-4-methoxybenzoic Acid
Controlled ProductRef: TR-B112270
250mg | 1,530.00 € |