CAS 2496-90-4
:4-Hydroxybenzoic acid 2-hydroxyethyl ester
Description:
4-Hydroxybenzoic acid 2-hydroxyethyl ester, also known as ethyl 4-hydroxybenzoate, is an organic compound characterized by its ester functional group derived from the reaction of 4-hydroxybenzoic acid and ethylene glycol. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The compound exhibits mild antimicrobial properties, making it useful in various applications, including as a preservative in cosmetics and pharmaceuticals. Additionally, it can serve as an intermediate in the synthesis of other chemical compounds. Its molecular structure features a hydroxyl group, which contributes to its reactivity and potential for hydrogen bonding. Safety data indicates that while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed to minimize exposure.
Formula:C9H10O4
InChI:InChI=1/C9H10O4/c10-5-6-13-9(12)7-1-3-8(11)4-2-7/h1-4,10-11H,5-6H2
SMILES:c1cc(ccc1C(=O)OCCO)O
Synonyms:- 2-Hydroxyethyl 4-Hydroxybenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Hydroxyethyl 4-Hydroxybenzoate
CAS:Formula:C9H10O4Purity:>98.0%(T)Color and Shape:White to Almost white powder to crystalMolecular weight:182.18Benzoic acid, 4-hydroxy-, 2-hydroxyethyl ester
CAS:Formula:C9H10O4Purity:98%Color and Shape:SolidMolecular weight:182.17334-Hydroxybenzoic acid 2-hydroxyethyl ester
CAS:4-Hydroxybenzoic acid 2-hydroxyethyl esterPurity:>98.0%Molecular weight:182.17g/mol4-Hydroxybenzoic acid 2-hydroxyethyl ester
CAS:4-Hydroxybenzoic acid 2-hydroxyethyl ester is an organic compound that is used in the synthesis of other organic compounds. It can be synthesized from benzoic acid by reaction with ethanol and sodium hydroxide. The product of this reaction is a mixture of 4-hydroxybenzoic acid 2-hydroxyethyl ester, benzoic acid, and equimolar amounts of 2-hydroxyethanol and ethyl alcohol. The hydrolysis of the ester group in 4-hydroxybenzoic acid 2-hydroxyethyl ester produces benzoic acid and ethyl alcohol. The alkylation reaction of the anion in 4-hydroxybenzoic acid 2-hydroxyethyl ester with deuterated benzene yields quantitatively benzaldehyde deuterated at one position on the benzene ring. This compound may also be used as a marker for hydrogen atoms that have been substituted with deuterFormula:C9H10O4Purity:Min. 95%Molecular weight:182.17 g/mol2-Hydroxyethyl 4-hydroxybenzoate
CAS:Formula:C9H10O4Purity:98%Color and Shape:SolidMolecular weight:182.175




