CAS 2496-90-4: 4-Hydroxybenzoic acid 2-hydroxyethyl ester

Description:4-Hydroxybenzoic acid 2-hydroxyethyl ester, also known as ethyl 4-hydroxybenzoate, is an organic compound characterized by its ester functional group derived from the reaction of 4-hydroxybenzoic acid and ethylene glycol. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water due to its hydrophobic aromatic structure. The compound exhibits mild antimicrobial properties, making it useful in various applications, including as a preservative in cosmetics and pharmaceuticals. Additionally, it can serve as an intermediate in the synthesis of other chemical compounds. Its molecular structure features a hydroxyl group, which contributes to its reactivity and potential for hydrogen bonding. Safety data indicates that while it is generally considered to have low toxicity, appropriate handling and safety measures should be observed to minimize exposure.

Formula:C₉H₁₀O₄

InChI:InChI=1/C9H10O4/c10-5-6-13-9(12)7-1-3-8(11)4-2-7/h1-4,10-11H,5-6H2

Synonyms:
2-Hydroxyethyl 4-Hydroxybenzoate

Found 5 products.

Product data	Purity	Price range	Estimated delivery
Benzoic acid, 4-hydroxy-, 2-hydroxyethyl ester REF: IN-DA002Q0ECAS: 2496-90-4	98%	30.00 €~123.00 €	Thu 17 Apr 25
2-Hydroxyethyl 4-Hydroxybenzoate REF: 3B-H0698CAS: 2496-90-4	>98.0%(T)	82.00 €	Tue 22 Apr 25
2-Hydroxyethyl 4-hydroxybenzoate REF: 10-F329998CAS: 2496-90-4	95.0%	138.00 €~224.00 €	Tue 22 Apr 25
4-Hydroxybenzoic acid 2-hydroxyethyl ester REF: 54-OR936885CAS: 2496-90-4	95%	32.00 €~1,150.00 €	Thu 24 Apr 25
4-Hydroxybenzoic acid 2-hydroxyethyl ester REF: 3D-FH66632CAS: 2496-90-4	Min. 95%	162.00 €~355.00 €	Mon 12 May 25