CAS 249647-24-3

methyl 3-bromo-4-iodobenzoate

Description:

Methyl 3-bromo-4-iodobenzoate is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both bromine and iodine atoms, as well as a methoxycarbonyl group (the ester functional group). This compound is typically a solid at room temperature and is soluble in organic solvents such as dichloromethane and acetone, but less soluble in water due to its hydrophobic nature. The presence of halogen substituents (bromine and iodine) on the benzene ring can influence its reactivity, making it a useful intermediate in various organic synthesis reactions, including cross-coupling reactions and nucleophilic substitutions. Additionally, the compound may exhibit interesting biological activities, which can be explored in medicinal chemistry. Its molecular structure contributes to its physical properties, such as melting point and boiling point, which are influenced by the steric and electronic effects of the substituents. Safety precautions should be taken when handling this compound, as halogenated compounds can pose health risks.

Formula: C₈H₆BrIO₂

InChI: InChI=1/C8H6BrIO2/c1-12-8(11)5-2-3-7(10)6(9)4-5/h2-4H,1H3

SMILES: COC(=O)c1ccc(c(c1)Br)I

Synonyms:

• 3-Bromo-4-Iodobenzoic Acid Methyl Ester

Benzoic acid, 3-bromo-4-iodo-, methyl ester

CAS: 249647-24-3

Formula: C₈H₆BrIO₂

Purity: 96%

Color and Shape: Solid

Molecular weight: 340.9405

Ref: IN-DA002Q0M

Methyl 3-bromo-4-iodobenzoate

CAS: 249647-24-3

Methyl 3-bromo-4-iodobenzoate

Formula: C₈H₆BrIO₂

Purity: ≥95%

Color and Shape: light yellow to orange solid

Molecular weight: 340.94g/mol

Ref: 54-OR321001

Methyl 3-bromo-4-iodobenzoate

CAS: 249647-24-3

Formula: C₈H₆BrIO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 340.942

Ref: 10-F226135