CAS 2497-58-7
:17-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]-3,6,9,12,15-pentaoxaheptadecan-1-ol
Description:
The chemical substance known as 17-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]-3,6,9,12,15-pentaoxaheptadecan-1-ol, with the CAS number 2497-58-7, is a polyether compound characterized by its long hydrophilic ether chain and a hydrophobic phenolic group. This structure imparts amphiphilic properties, making it useful as a surfactant or emulsifier in various applications, including pharmaceuticals, cosmetics, and industrial formulations. The presence of the bulky tetramethylbutyl group enhances its hydrophobic character, contributing to its effectiveness in stabilizing emulsions and dispersions. Additionally, the multiple ether linkages provide flexibility and solubility in various solvents. The compound is typically non-toxic and biodegradable, aligning with the increasing demand for environmentally friendly chemical substances. Its unique structure allows for specific interactions with biological membranes, which can be advantageous in drug delivery systems. Overall, this compound exemplifies the versatility of polyether surfactants in both industrial and consumer products.
Formula:C26H46O7
InChI:InChI=1S/C26H46O7/c1-25(2,3)22-26(4,5)23-6-8-24(9-7-23)33-21-20-32-19-18-31-17-16-30-15-14-29-13-12-28-11-10-27/h6-9,27H,10-22H2,1-5H3
InChI key:InChIKey=SQAUJCLQNBQZMT-UHFFFAOYSA-N
SMILES:C(CC(C)(C)C)(C)(C)C1=CC=C(OCCOCCOCCOCCOCCOCCO)C=C1
Synonyms:- 17-[4-(1,1,3,3-Tetramethylbutyl)phenoxy]-3,6,9,12,15-pentaoxaheptadecan-1-ol
- 3,6,9,12,15-Pentaoxaheptadecan-1-ol, 17-[4-(1,1,3,3-tetramethylbutyl)phenoxy]-
- 3,6,9,12,15-Pentaoxaheptadecan-1-ol, 17-[p-(1,1,3,3-tetramethylbutyl)phenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
