CAS 24973-49-7
:2-Cyanobiphenyl
Description:
2-Cyanobiphenyl, with the CAS number 24973-49-7, is an organic compound that belongs to the class of biphenyl derivatives. It features a biphenyl structure where a cyano group (-CN) is attached to the second position of one of the phenyl rings. This compound is typically a colorless to pale yellow solid at room temperature and is known for its relatively high melting point. 2-Cyanobiphenyl is characterized by its aromatic nature, which contributes to its stability and potential applications in organic synthesis and materials science. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. The presence of the cyano group imparts unique electronic properties, making it useful in various applications, including as a building block in the synthesis of liquid crystals and other functional materials. Additionally, 2-Cyanobiphenyl may exhibit interesting photophysical properties, which can be exploited in optoelectronic devices. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and environmental impact.
Formula:C13H9N
InChI:InChI=1/C13H9N/c14-10-12-8-4-5-9-13(12)11-6-2-1-3-7-11/h1-9H
SMILES:c1ccc(cc1)c1ccccc1C#N
Synonyms:- (1,1'-Biphenyl)-2-carbonitrile
- Biphenyl-2-Carbonitrile
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Cyanobiphenyl
CAS:Formula:C13H9NPurity:98%Color and Shape:Solid, Low Melting SolidMolecular weight:179.2222-Cyanobiphenyl
CAS:2-Cyanobiphenyl is a versatile research chemical that has various applications in the field of chemistry. It is a biphenyl compound that is commonly used as a fluorescent probe in scientific experiments. The chemical structure of 2-Cyanobiphenyl makes it an ideal candidate for studying phase transitions and solid-state NMR (Nuclear Magnetic Resonance). Researchers often use this compound to investigate the phase transition temperature and properties of different materials, such as nematic liquid crystals.Formula:C13H9NPurity:Min. 95%Molecular weight:179.22 g/mol



