CAS 249889-70-1

1,6-Naphthyridin-4-amine, hydrochloride (1:1)

Description:

1,6-Naphthyridin-4-amine, hydrochloride (1:1) is a chemical compound characterized by its naphthyridine core, which consists of a bicyclic structure containing nitrogen atoms. This compound features an amine functional group at the 4-position of the naphthyridine ring, contributing to its basicity and potential reactivity. The hydrochloride form indicates that the compound is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical research. The presence of nitrogen in the ring structure may impart specific biological activities, making it of interest in medicinal chemistry. Additionally, the compound's molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic purposes. As with many organic compounds, handling should be done with care, considering safety data and proper laboratory protocols. Overall, 1,6-Naphthyridin-4-amine, hydrochloride is a versatile compound with potential applications in drug development and research.

Formula: C₈H₇N₃·ClH

InChI: InChI=1S/C8H7N3.ClH/c9-7-1-4-11-8-2-3-10-5-6(7)8;/h1-5H,(H2,9,11);1H

InChI key: InChIKey=DRYXZLOBKCGHOT-UHFFFAOYSA-N

SMILES: NC=1C2=C(N=CC1)C=CN=C2.Cl

Synonyms:

• 1,6-Naphthyridin-4-amine, hydrochloride (1:1)
• 1,6-Naphthyridin-4-amine, monohydrochloride

1,6-Naphthyridin-4-amine hydrochloride

CAS: 249889-70-1

Formula: C₈H₈ClN₃

Molecular weight: 181.6222

Ref: IN-DA002Q30

[1,6]Naphthyridin-4-ylamine hydrochloride

CAS: 249889-70-1

Versatile small molecule scaffold

Formula: C₈H₈ClN₃

Purity: Min. 95%

Molecular weight: 181.62 g/mol

Ref: 3D-ZJA88970