CAS 25006-60-4
:Acetic acid, 2,2-dichloro-, 1-methylethyl ester
Description:
Acetic acid, 2,2-dichloro-, 1-methylethyl ester, also known by its CAS number 25006-60-4, is an organic compound that belongs to the class of esters. It is characterized by its ester functional group, which is formed from the reaction of acetic acid and an alcohol. This compound typically appears as a colorless liquid with a distinctive odor. It is known for its moderate volatility and solubility in organic solvents, while being less soluble in water. The presence of dichloro groups in its structure imparts specific chemical properties, including potential reactivity and environmental considerations. Acetic acid esters are often used in various applications, including as solvents, plasticizers, and in the synthesis of other chemical compounds. Safety data indicates that it may pose health risks if inhaled or ingested, necessitating appropriate handling and storage measures. Overall, this compound is significant in both industrial and laboratory settings, contributing to various chemical processes and formulations.
Formula:C5H8Cl2O2
InChI:InChI=1S/C5H8Cl2O2/c1-3(2)9-5(8)4(6)7/h3-4H,1-2H3
InChI key:InChIKey=JBTISLVNJCYZCH-UHFFFAOYSA-N
SMILES:C(OC(C)C)(C(Cl)Cl)=O
Synonyms:- 1-Methylethyl 2,2-dichloroacetate
- 1-Methylethyl dichloroacetate
- Acetic acid, 2,2-dichloro-, 1-methylethyl ester
- Acetic acid, dichloro-, 1-methylethyl ester
- Acetic acid, dichloro-, isopropyl ester
- Dichloroacetic acid isopropyl ester
- Propan-2-Yl Dichloroacetate
- Isopropyl dichloroacetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

