CAS 25015-92-3

2-chloro-1-(2,4-dihydroxyphenyl)ethanone

Description:

2-Chloro-1-(2,4-dihydroxyphenyl)ethanone, with the CAS number 25015-92-3, is an organic compound characterized by its functional groups and structural features. It contains a chloro substituent and a ketone group, which contribute to its reactivity and potential applications in organic synthesis. The presence of two hydroxyl groups on the phenyl ring enhances its polarity and solubility in polar solvents, while also providing sites for potential hydrogen bonding. This compound may exhibit biological activity due to its structural similarity to various phenolic compounds, which are known for their antioxidant properties. Additionally, the chlorinated structure can influence its stability and reactivity, making it a candidate for further chemical modifications. In terms of safety, like many chlorinated compounds, it may pose environmental and health risks, necessitating careful handling and disposal. Overall, 2-chloro-1-(2,4-dihydroxyphenyl)ethanone is of interest in both synthetic chemistry and potential pharmacological applications.

Formula: C₈H₇ClO₃

InChI: InChI=1/C8H7ClO3/c9-4-8(12)6-2-1-5(10)3-7(6)11/h1-3,10-11H,4H2

SMILES: c1cc(c(cc1O)O)C(=O)CCl

Synonyms:

• 2-Chloro-2',4'-Dihydroxyacetophenone

Ethanone, 2-chloro-1-(2,4-dihydroxyphenyl)-

CAS: 25015-92-3

Formula: C₈H₇ClO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 186.5924

Ref: IN-DA002Q6E

Isoprenaline Impurity 29

CAS: 25015-92-3

Formula: C₈H₇ClO₃

Molecular weight: 186.59

Ref: 4Z-I-4534

2-Chloro-1-(2,4-dihydroxy-phenyl)-ethanone

CAS: 25015-92-3

Formula: C₈H₇ClO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 186.59

Ref: 10-F059423

2-Chloro-1-(2,4-dihydroxy-phenyl)-ethanone

CAS: 25015-92-3

2-Chloro-1-(2,4-dihydroxy-phenyl)-ethanone (CDPE) is a neutralizing chemical that can be used for the detection of various organic solvents. It reacts with the solvent to form a fluorescent compound. CDPE has high specificity and can detect a wide range of solvents, including chlorinated hydrocarbons, alcohols, ketones, and esters. The reaction between CDPE and the solvent generates a fluorescence signal that can be detected by UV light at 365 nm or 366 nm. This probe is sensitive enough to detect as little as 0.02 mg/L of chloroform in water. CDPE is soluble in alkaline solutions but not in acidic solutions and therefore will only react with an alkaline solution when it is mixed with an organic solvent. The reaction between CDPE and the solvent generates a fluorescence signal that can be detected by UV light at 365 nm

Formula: C₈H₇ClO₃

Purity: Min. 95%

Molecular weight: 186.59 g/mol

Ref: 3D-ABA01592

Isoproterenol Impurity 7

CAS: 25015-92-3

Formula: C₈H₇ClO₃

Molecular weight: 186.59

Ref: ST-EA-CP-I19012